Nimesulide
Nimesulide-d5 · Nimesulide for peak identification · N-(4-NITRO-2-PHENOXYPHENYL)METHANESULFONAMIDE · Nide · Nidol · nimed · AULIN · R-805
식별자 및 물리적 특성
| CAS No. | 51803-78-2 |
|---|---|
| 분자식 | C13H12N2O5S |
| 평균 분자량 | 308.31 g/mol |
| 단동위원소 질량 | 308.04669266 g/mol |
| SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1Oc1ccccc1 |
| InChIKey | HYWYRSMBCFDLJT-UHFFFAOYSA-N |
| PubChem CID | 4495 |
| ChEMBL | CHEMBL56367 |
| ChEBI | CHEBI:44445 |
| EC No. | 257-431-4 |
| DTXSID | DTXSID3037250 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 110 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 450 |
| 녹는점 | 140-146°C |
| 끓는 점 | 442.0±55.0 °C(Predicted) |
| 밀도 | 1.451±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 용해도 | 물에 거의 녹지 않으며, 아세톤에 잘 녹고, 무수 에탄올에 약간 녹습니다. |
| pKa(산도 계수) | pKa 6.56± 0.03(H2O,t =25,I=0.02)(Approximate) |
| 물리적 상태 | Solid |
| 색상 | Light orange to Yellow to Green |
| 생물학적 소스 | synthetic (organic) |
| 용해도 | 수용성(<50μg/ml), 1:10 DMSO:PBS(pH 7.2)(<200μg/ml), 에탄올(1mg/ml), DMSO (15mg/ml), DMF(15mg/ml), 에 용해됨클로로포름, 에 용해됨디클로로메탄, 아세톤(자유롭게 용해됨) 및 1N NaOH. |
| Merck | 14,6548 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 의약품(소분자) |
| InChI | 1S/C13H12N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h2-9,14H,1H3 |
| InChIKey | HYWYRSMBCFDLJT-UHFFFAOYSA-N |
| SMILES | CS(NC1=C(OC2=CC=CC=C2)C=C([N+]([O-])=O)C=C1)(=O)=O |
| EPA | Methanesulfonamide, N-(4-nitro-2-phenoxyphenyl)- (51803-78-2) |
화학적 성질
Yellow Needle-Like Crystals
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | PB0970000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 독성 | LD50 orally in rats: 324 mg/kg (Swingle, Moore) |
| 관세 코드 | 2935.90.9500 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36-26 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 3 Oral |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
개요
Nimesulide is a relatively COX-2 selective, non-steroidal anti-inflammatory drug (NSAID) with analgesic and antipyretic properties. It is indicated for the treatment of acute pain, symptomatic treatment of osteoarthritis and primary dysmenorrhoea in adolescents and adults. However, due to the risk of causing hepatotoxicity, it should not be taken long-term. It has also been withdrawn from the markets in many countries. It mechanism of action is through targeting on various key mediators in the inflammatory process such as COX-2 mediated prostaglandins, free radicals, proteolytic enzymes and histamine.
용도
Labelled Nimesulide (N477500). Antiinflammatory agent. Preferentially inhibits COX-2 over COX-1. Suppresses chemical-induced carcinogenesis in mice and rats. Inhibits LPS-induced TNF-α production.
일반 설명
Nimesulide, a nonsteroidal anti-inflammatory drug (NSAID) belongs to the sulfonanilide class.