Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(4-methoxyphenyl)-N-methylmethanamine
1-(4-methoxyphenyl)-N-methylmethanamine · 4-METHOXY-N-METHYLBENZYLAMINE · )-N-MethyL · AKOS BC-0897 · JACS-702-24-9 · N-(4-Methoxybenzyl)- · N-Methyl-4-methoxybenzylamine · (4-METHOXY-BENZYL)-METHYL-AMINE
식별자 및 물리적 특성
| CAS No. | 702-24-9 |
|---|---|
| 분자식 | C9H13NO |
| 평균 분자량 | 151.21 g/mol |
| 단동위원소 질량 | 151.09971404 g/mol |
| SMILES | CNCc1ccc(OC)cc1 |
| InChIKey | AIJFPNKGGAPZFJ-UHFFFAOYSA-N |
| PubChem CID | 485407 |
| ChEMBL | CHEMBL1178119 |
| EC No. | 662-855-1 |
| DTXSID | DTXSID80220466 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 21.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 97.7 |
| 녹는점 | 238 °C |
| 끓는 점 | 88 °C |
| 밀도 | 1.008 g/mL at 25 °C |
| 굴절률 | n20/D1.529 |
| 인화점 | 109℃ |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 기름 |
| pKa(산도 계수) | 10.14±0.10(Predicted) |
| 색상 | 클리어 베이지 |
| InChI | InChI=1S/C9H13NO/c1-10-7-8-3-5-9(11-2)6-4-8/h3-6,10H,7H2,1-2H3 |
| InChIKey | AIJFPNKGGAPZFJ-UHFFFAOYSA-N |
| SMILES | C1(CNC)=CC=C(OC)C=C1 |
안전 및 규제
| GHS 분류 | WarningH302 (93.2%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 7 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Cease Manufacture Update: 04-10-2016 https://echa.europa.eu/registration-dossier/-/registered-dossier/18136 |
| Hazard Classes and Categories | Acute Tox. 4 (93.2%) |
| 수질 위해 등급(WGK) | 1 |
| 운송 번호(UN) | UN 2735 8/PG III |
| 관세 코드 | 2921490090 |
| 위험 문구(R) | 36/37/38-34-22 |
| 위험 표시 | C,Xn |
| 안전 문구(S) | 26-36/37/39 |
| 포장분류 | III |
| 위험 등급 | 8 |
용도
용도
N-(4-Methoxybenzyl)-N-methylamine is used in the synthetic preparation of many types of compounds, including the synthesis of trifluoromethyl-sulfonimidamides from sulfinamides as well as the preparation of piperazinylquinazoline amine compounds as toll-like receptor 9 signaling antagonists for treatment of immune disorders.