Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl Ferulate
FERULIC ACID ETHYL ESTER · 2-Propenoic a · BUTTPARK 121\04-55 · Methyl(E)-ferulate · RARECHEM AL BI 0735 · Methyl trans-ferulate · Acrylic acid methyl este · (E)-Ferulic acid methyl ester
식별자 및 물리적 특성
| CAS No. | 22329-76-6 |
|---|---|
| 분자식 | C11H12O4 |
| 평균 분자량 | 208.21 g/mol |
| 단동위원소 질량 | 208.07355886 g/mol |
| SMILES | COC(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChIKey | AUJXJFHANFIVKH-GQCTYLIASA-N |
| PubChem CID | 5357283 |
| ChEMBL | CHEMBL32969 |
| ChEBI | CHEBI:67379 |
| EC No. | 606-986-4 |
| DTXSID | DTXSID701377891 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 55.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 237 |
| LogP(분배 계수) | 1.2 |
| 녹는점 | 63-65 °C(lit.) |
| 끓는 점 | 164-166 °C0.5 mm Hg(lit.) |
| 밀도 | 1.204±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 8.88±0.18(Predicted) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
용도
용도
Methyl (2E)-3-(4-Hydroxy-3-methoxyphenyl)acrylate used in method for preparation of Photoaligning polymer materials and compounds.