Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
무염소테트라사이클린염화물
무염소테트라사이클린염화물 · ACTC · ASD5 · CMD1R · CMH11 · LVNC4 · acta1b · MGC110101
식별자 및 물리적 특성
| CAS No. | 4497-08-9 |
|---|---|
| 분자식 | C22H21ClN2O7 |
| 평균 분자량 | 460.9 g/mol |
| SMILES | Cc1c2c(c(O)c3c(O)ccc(Cl)c13)C(=O)[C@]1(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]1C2 |
| InChIKey | NICZYMKKWKYGHT-BAQLRCJTSA-N |
| PubChem CID | 54693278 |
| ChEBI | CHEBI:81648 |
| DTXSID | DTXSID50912301 |
| 현지명 | 무염소테트라사이클린염화물 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 161 |
| 수소 결합 공여자 수 | 5 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 32 |
| 형식 전하 | 0 |
| 복잡도 | 892 |
| 의약품 | Pharmaceuticals -> Antibiotics |
| 녹는점 | 250 °C |
| 끓는 점 | 709.3±60.0 °C(Predicted) |
| 밀도 | 1.67±0.1 g/cm3(Predicted) |
| 저장 조건 | -20°C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 완충 수용액 |
| pKa(산도 계수) | 4.46±0.70(Predicted) |
| 색상 | 주황색에서 진한 주황색까지 |
| 안정성 | 감광성, 온도 민감성 |
| EPA | 2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,12,12a-hexahydro-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-, (4S,4aS,12aS)- (4497-08-9) |
안전 및 규제
| 규제 정보 | 2-Naphthacenecarboxamide, 7-chloro-4-(dimethylamino)-1,4,4a,5,12,12a-hexahydro-3,10,11,12a-tetrahydroxy-6-methyl-1,12-dioxo-, (4S,4aS,12aS)-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|---|
| 위험 문구(R) | 63-36 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36/37/39-26 |
용도
용도
Anhydrochlortetracycline is a degradation product of chlortetracycline formed by acid-catalysed isomerisation of the dimethylamino group at C4. Anhydrochlortetracycline exhibits little antibiotic activity but its abundance is indicative of poor storage and handling of chlortetracycline.