Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-5-methoxypyrimidine
2-Chloro-5-methoxypyrimidine · PyriMidine,2-chloro-5-Methoxy- · 2-Chloro-5-methoxypyrimidine >2-Chloro-5-MethoxypyriMidine 97% · 2-CHLORO-5-(METHOXY-D3)PYRIMIDINE · 2-Chloro-5-methoxypyrimidine, 97%, · Pyrimidine, 2-chloro-5-methoxy- (8CI,9CI) · 2-Chloro-5-methoxypyrimidine ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 22536-65-8 |
|---|---|
| 분자식 | C5H5ClN2O |
| 평균 분자량 | 144.56 g/mol |
| 단동위원소 질량 | 144.00904046 g/mol |
| SMILES | COc1cnc(Cl)nc1 |
| InChIKey | RSUBGBZOMBTDTI-UHFFFAOYSA-N |
| PubChem CID | 589058 |
| EC No. | 636-584-4 |
| DTXSID | DTXSID60343329 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 35 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 83 |
| 녹는점 | 73-78℃ |
| 끓는 점 | 268.8±13.0 °C(Predicted) |
| 밀도 | 1.292±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | -1.26±0.22(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| InChI | InChI=1S/C5H5ClN2O/c1-9-4-2-7-5(6)8-3-4/h2-3H,1H3 |
| InChIKey | RSUBGBZOMBTDTI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(OC)C=N1 |
화학적 성질
off-white powder
안전 및 규제
| GHS 분류 | DangerH302 (93%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (93%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 37/38-41 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-39 |
| 위험 등급 | Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Chloro-5-methoxypyrimidine is used in the regioselective synthesis of aminoimidazopyrimidines with triflic anhydride and pyridine bases