Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에틸2,3,4,5-테트라플루오로벤조일아세테이트
에틸2,3,4,5-테트라플루오로벤조일아세테이트 · Ethyl 2 · SKL919 · Levofloxacin-17 · Levofloxacin Impurity V · 5-tetrafluorobenzoyl acetate · Ethyl(2,3,4,5-tetrafluorobenzo · ethy-2,3,4,5-tetrafluorobenzoylacetate
식별자 및 물리적 특성
| CAS No. | 94695-50-8 |
|---|---|
| 분자식 | C11H8F4O3 |
| 평균 분자량 | 264.17 g/mol |
| 단동위원소 질량 | 264.040957 g/mol |
| SMILES | CCOC(=O)CC(=O)c1cc(F)c(F)c(F)c1F |
| InChIKey | KWDVJYLIAJHEOW-UHFFFAOYSA-N |
| PubChem CID | 600916 |
| EC No. | 700-167-6 |
| DTXSID | DTXSID70344983 |
| 현지명 | 에틸2,3,4,5-테트라플루오로벤조일아세테이트 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 43.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 323 |
| 녹는점 | 41-44°C |
| 끓는 점 | 100 °C / 0.1mmHg |
| 밀도 | 1.384 |
| 인화점 | 123℃ |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | DMSO및메탄올에 용해됨 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 10.51±0.50(Predicted) |
| 색상 | 미색부터 베이지까지 |
| InChI | InChI=1S/C11H8F4O3/c1-2-18-8(17)4-7(16)5-3-6(12)10(14)11(15)9(5)13/h3H,2,4H2,1H3 |
| InChIKey | KWDVJYLIAJHEOW-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(C1=CC(F)=C(F)C(F)=C1F)=O |
화학적 성질
White or off-white crystal
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Active Update: 26-01-2011 https://echa.europa.eu/registration-dossier/-/registered-dossier/1112 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 29183000 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 위험 참고 사항 | Irritant |
용도
용도
Ethyl 2,3,4,5-tetrafluorobenzoyl acetate is a fluorinated benzoylacetate used as a synthetic reagent in the preparation of antibacterial and potential antitumor agents.