Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,4-디비닐벤제
1,4-디비닐벤제 · p-디비닐벤젠 · P-디비닐벤젠85 · PARA-DIVINYLBENZENE · JACS-105-06-6 · 4-Vinylstyrene · p-vinylstyrene · paradienebenzene
식별자 및 물리적 특성
| CAS No. | 105-06-6 |
|---|---|
| 분자식 | C10H10 |
| 평균 분자량 | 130.19 g/mol |
| 단동위원소 질량 | 130.07825032 g/mol |
| SMILES | C=Cc1ccc(C=C)cc1 |
| InChIKey | WEERVPDNCOGWJF-UHFFFAOYSA-N |
| PubChem CID | 66041 |
| ChEMBL | CHEMBL1520722 |
| EC No. | 203-266-8 |
| DTXSID | DTXSID2033863 |
| 현지명 | 1,4-디비닐벤제 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 100 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP(분배 계수) | 3.2 |
| 녹는점 | 31°C |
| 끓는 점 | 175.9°C (rough estimate) |
| 밀도 | 0.914 g/mL at 25 °C (lit.) |
| 증기압 | 71.06Pa at 25℃ |
| 굴절률 | n20/D 1.5470(lit.) |
| 인화점 | 148 °F |
| 저장 조건 | -70°C |
| 물리적 상태 | 저융점 고체 |
| 색상 | Clear, colourless |
| 용해도 | 1μg/L |
| InChI | InChI=1S/C10H10/c1-3-9-5-7-10(4-2)8-6-9/h3-8H,1-2H2 |
| InChIKey | WEERVPDNCOGWJF-UHFFFAOYSA-N |
| SMILES | C1(C=C)=CC=C(C=C)C=C1 |
| LogP(분배 계수) | 4.46 at 25℃ |
| EPA | p-Divinylbenzene (105-06-6) |
안전 및 규제
| GHS 분류 | DangerH302 (84.3%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P272, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P333+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.H304: May be fatal if swallowed and enters airways [Danger Aspiration hazard] |
|---|---|
| 규제 정보 | Status: Active Update: 27-05-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/17357 |
| Hazard Classes and Categories | Acute Tox. 4 (84.3%)Skin corrosion/irritation - Category 2 |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | NA 1993 / PGIII |
| 관세 코드 | 2902900000 |
| 위험 문구(R) | 22-36/37/38-43 |
| 위험 표시 | Xn |
| 안전 문구(S) | 7-23-26-36-45-36/37 |
| 위험 등급 | Acute Tox. 4 OralAquatic Chronic 2Eye Irrit. 2Skin Irrit. 2 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
DVB can be cross-linked with styrene/vinylbenzene chloride and incorporated with multi-walled carbon nanotubes (MWCNTs) to form new microporous nanocomposites for water remediation. It can also be used in combination with polyethylene glycol diacrylate to form linkages with polyethylene oxide (PEO), which can be used as an electrolytic material for lithium batteries.
일반 설명
p-Divinylbenzene(DVB) is a cross-linking agent, which is used in a variety of polymeric processes such as copolymerization of styrene to improve the thermo-mechanical properties of the composite.