Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,5-디메틸-3-퓨로익산
2,5-디메틸-3-퓨로익산 · 2,5-DIMETHYLFURAN-3-CARBOXYLIC ACID · pyrotritaric acid · TIMTEC-BB SBB004165 · 2,5-DIMETHYL-3-FUORIC ACID · 2,5-Dimethyl-3-furoic acid · 2,5-Dimethyl-3-furoic acid,98% · 2,5-Dimethyl-3-furoic acid 98%
식별자 및 물리적 특성
| CAS No. | 636-44-2 |
|---|---|
| 분자식 | C7H8O3 |
| 평균 분자량 | 140.14 g/mol |
| 단동위원소 질량 | 140.04734412 g/mol |
| SMILES | Cc1cc(C(=O)O)c(C)o1 |
| InChIKey | CNTHHNPBADVTRY-UHFFFAOYSA-N |
| PubChem CID | 69465 |
| EC No. | 211-257-5 |
| DTXSID | DTXSID30212977 |
| 현지명 | 2,5-디메틸-3-퓨로익산 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 50.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 144 |
| 녹는점 | 137-140 °C (lit.) |
| 끓는 점 | 240.6±35.0 °C(Predicted) |
| 밀도 | 1.194±0.06 g/cm3(Predicted) |
| 저장 조건 | Storage temp. 2-8°C |
| pKa(산도 계수) | 4.56±0.26(Predicted) |
| 물리적 상태 | powder to crystaline |
| 색상 | White to Orange to Green |
| InChI | InChI=1S/C7H8O3/c1-4-3-6(7(8)9)5(2)10-4/h3H,1-2H3,(H,8,9) |
| InChIKey | CNTHHNPBADVTRY-UHFFFAOYSA-N |
| SMILES | O1C(C)=CC(C(O)=O)=C1C |
화학적 성질
white to faint yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3261 |
| 관세 코드 | 29321900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2,5-Dimethyl-3-furoic acid may be used as carboxylato ligand in the preparation of the following titanocene complexes:[Ti(η5-C5H5)2(OOC-dmf)2][Ti(η5-C5H4Me)2(OOC-dmf)2]