Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,3,4,5,6-펜타플루오로페닐아세토니트릴
2,3,4,5,6-펜타플루오로페닐아세토니트릴 · pentaflurochlorobenzene · PENTAFLUOROPHENYLACETONITRILE · Pentafluorobenzeneacetonitrile · 2-(Perfluorophenyl)acetonitrile · Pentafluorophenylacetonitrile98% · Pentafluorophenylacetonitrile 98% · 2-(Pentafluorophenyl)acetonitrile
식별자 및 물리적 특성
| CAS No. | 653-30-5 |
|---|---|
| 분자식 | C8H2F5N |
| 평균 분자량 | 207.1 g/mol |
| 단동위원소 질량 | 207.01074016 g/mol |
| SMILES | N#CCc1c(F)c(F)c(F)c(F)c1F |
| InChIKey | YDNOJUAQBFXZCR-UHFFFAOYSA-N |
| PubChem CID | 69554 |
| ChEMBL | CHEMBL1977371 |
| EC No. | 211-498-6 |
| DTXSID | DTXSID10215643 |
| 현지명 | 2,3,4,5,6-펜타플루오로페닐아세토니트릴 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 233 |
| 끓는 점 | 107-111 °C17 mm Hg(lit.) |
| 밀도 | 1.61 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.439(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Storage temp. 2-8°C |
| 물리적 상태 | 액체 |
| 색상 | 무색투명~미황색 |
| 비중 | 1.610 |
| 용해도 | 물에 불용성. |
| BRN | 1882341 |
화학적 성질
clear colorless to slightly yellow liquid
안전 및 규제
| GHS 분류 | WarningH302 (95.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95.9%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3276 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,T,Xi |
| 안전 문구(S) | 26-37/39 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
| 위험 참고 사항 | Toxic |
용도
용도
2,3,4,5,6-Pentafluorophenylacetonitrile is used as medicine and liquid crystal materials intermediates. Ortho or para substituted dimers and a mixture of trimers, tetramers and pentamers of PFPA coulb be obtained from 2,3,4,5,6-Pentafluorophenylacetonitrile.