Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디(2-피리딜)티오노카보네이트
디(2-피리딜)티오노카보네이트 · DI-2-피리딜티오노카보네이트 · O,O-di(pyridin-2-yl) carbonothioate · O,O-dipyridin-2-yl thiocarbonate · Bispyridylthiocarbonate · DI-2-PYRIDYL THIONOCARBONATE · 2-pyridyl thionocarbonate,97% · Dipyridin-2-yloxymethanethione
식별자 및 물리적 특성
| CAS No. | 96989-50-3 |
|---|---|
| 분자식 | C11H8N2O2S |
| 평균 분자량 | 232.26 g/mol |
| 단동위원소 질량 | 232.0306485 g/mol |
| SMILES | S=C(Oc1ccccn1)Oc1ccccn1 |
| InChIKey | IKYOVSVBLHGFMA-UHFFFAOYSA-N |
| PubChem CID | 719784 |
| EC No. | 628-173-3 |
| DTXSID | DTXSID10352128 |
| 현지명 | 디(2-피리딜)티오노카보네이트 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 76.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 216 |
| 녹는점 | 94-98 °C(lit.) |
| 끓는 점 | 359℃ |
| 밀도 | 1.340 |
| 인화점 | 171℃ |
| 저장 조건 | -20°C |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 0.11±0.12(Predicted) |
| 색상 | 노란색에서 갈색으로 |
| 용해도 | 물에 불용성(9280g/L). |
| BRN | 4314435 |
| InChI | InChI=1S/C11H8N2O2S/c16-11(14-9-5-1-3-7-12-9)15-10-6-2-4-8-13-10/h1-8H |
| InChIKey | IKYOVSVBLHGFMA-UHFFFAOYSA-N |
| SMILES | C(=S)(OC1=NC=CC=C1)OC1=NC=CC=C1 |
화학적 성질
Yellow to brown crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| F 고인화성물질 | 4.4-10-21 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Di-2-pyridyl thionocarbonate is used in the synthesis of 10-des(carbamoyloxy)-10-isothiocyanatoporfiromycin. It is also used as a substitute of thiophosgene, in the preparation of isothiocyanate.