Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Benzoic acid, 2-amino-5-iodo-
5-IODOANTHRANILIC ACID · TIMTEC-BB SBB001006 · 5-iodoanthranil acid · 5-Iodoanthanilic acid · 5-iodo-anthranilicaci · 2-Amino-5-iodobenzoic · 5-Iodoanthranillic acid · 5-IodoanthranilicAcid>5-lodo anthranillic acid
식별자 및 물리적 특성
| CAS No. | 5326-47-6 |
|---|---|
| 분자식 | C7H6INO2 |
| 평균 분자량 | 263.03 g/mol |
| 단동위원소 질량 | 262.94432643 g/mol |
| SMILES | Nc1ccc(I)cc1C(=O)O |
| InChIKey | GOLGILSVWFKZRQ-UHFFFAOYSA-N |
| PubChem CID | 72911 |
| EC No. | 226-205-7 |
| DTXSID | DTXSID1063776 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 63.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 163 |
| LogP(분배 계수) | 2.67 |
| 녹는점 | 219-221 °C (dec.) (lit.) |
| 끓는 점 | 383.2±37.0 °C(Predicted) |
| 밀도 | 1.8886 (estimate) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 4.59±0.10(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 베이지 또는 회색에서 보라색까지 |
| 용해도 | 알코올에 용해됩니다. 물에 불용성. |
| BRN | 639029 |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C7H6INO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | GOLGILSVWFKZRQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(I)=CC=C1N |
| EPA | 5-Iodoanthranilic acid (5326-47-6) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DG2802000 |
| 관세 코드 | 29224995 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | IRRITANT, LIGHT SENSITIVEEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Amino-5-iodobenzoic acid is used in wide range of medicals industrial applications as well as in human and animal nutrition products such as pharmaceutical intermediates, polarizing films for Liquid Crystal Display (LCD) chemicals.