Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-벤질록시-3-메톡시벤잘데하이드
4-벤질록시-3-메톡시벤잘데하이드 · NSC 44876 · NSC 22599 · NSC 208757 · ASISCHEM N39068 · BENZYL VANILLIN · O-BENZYLVANILLIN · ZERENEX E/4048067
식별자 및 물리적 특성
| CAS No. | 2426-87-1 |
|---|---|
| 분자식 | C15H14O3 |
| 평균 분자량 | 242.27 g/mol |
| 단동위원소 질량 | 242.09429431 g/mol |
| SMILES | COc1cc(C=O)ccc1OCc1ccccc1 |
| InChIKey | JSHLOPGSDZTEGQ-UHFFFAOYSA-N |
| PubChem CID | 75506 |
| ChEMBL | CHEMBL3278089 |
| EC No. | 219-379-0 |
| DTXSID | DTXSID80178958 |
| 현지명 | 4-벤질록시-3-메톡시벤잘데하이드 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 35.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 248 |
| 물질 분류 | Other Classes -> Benzaldehydes |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Physical Description | Beige crystalline solid[Sigma-Aldrich MSDS] |
| 녹는점 | 62-64 °C (lit.) |
| 끓는 점 | 213-215°C 3,5mm |
| 밀도 | 1.1515 (rough estimate) |
| 굴절률 | 1.5570 (estimate) |
| 인화점 | 213-215°C/3.5mm |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 클로로포름, 메탄올에 용해됩니다. |
| 물리적 상태 | 고체 |
| 색상 | 황백색에서 연한 노란색 |
| BRN | 1464258 |
| InChI | InChI=1S/C15H14O3/c1-17-15-9-13(10-16)7-8-14(15)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| InChIKey | JSHLOPGSDZTEGQ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OCC2=CC=CC=C2)C(OC)=C1 |
화학적 성질
YELLOW CRYSTALLINE POWDER OR CRYSTALLINE CHUNKS
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | May cause irritation[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29125000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-37-26 |
| 위험 등급 | IRRITANT |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Benzyloxy-3-methoxybenzaldehyde was used in the synthesis of 1,2-bis(4-benzyloxy-3-methoxyphenyl)-3-hydroxy-propionic acid1. It was also used in first enantioselective total synthesis of a neurotrophic (-)-talaumidin. 4-Benzyloxy-3-methoxybenzaldehyde reacts with benzohydrazide to yield (E)-N-(4-benzyloxy-3-methoxybenzylidene)benzohydrazide.
일반 설명
4-Benzyloxy-3-methoxybenzaldehyde reacts with benzohydrazide to yield (E)-N′-(4-benzyloxy-3-methoxybenzylidene)benzohydrazide.