Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Perfluoropentanoic acid
PERFLUOROVALERIC ACID · 2,2,3,3,4,4,5,5,5-Nonafluoropentanoic acid · Perfluoropentanoicacid,97% · Pentanoic acid, nonafluoro- · NSC 18404 · IPC-PFFA-5 · uoropentanoic acid · RARECHEM AL BO 2315
식별자 및 물리적 특성
| CAS No. | 2706-90-3 |
|---|---|
| 분자식 | C5HF9O2 |
| 평균 분자량 | 264.05 g/mol |
| 단동위원소 질량 | 263.98328325 g/mol |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChIKey | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| PubChem CID | 75921 |
| ChEMBL | CHEMBL173263 |
| ChEBI | CHEBI:83491 |
| EC No. | 220-300-7 |
| DTXSID | DTXSID6062599 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 11 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 291 |
| 물질 분류 | Ionic Liquids -> Fluorinated Ionic Liquids |
| PFAS | PFAS -> Perfluorocarboxylic acidsPFAS -> Other/unspecifiedPFAS -> Perfluoroalkyl acids (PFAAs)PFAS -> PFcarboxylic acids (PFCA)PFAS (C5HF9O2) |
| Collision Cross Section | 117.4 Ų [M-H-CO2]- [CCS Type: DTBuffer gas: N2Ionization: ESI-Dataset: PFAS]179.96 Ų [2M-H]- |
| 끓는 점 | 140 °C(lit.) |
| 밀도 | 1.713 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.294(lit.) |
| 인화점 | 140°C |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMF: 10 mg/mlDMSO: 10 mg/mlEthanol: 10 mg/mlPBS (pH 7.2): 1 mg/ml |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 0.40±0.10(Predicted) |
| 색상 | 밝은 노란색에서 밝은 갈색까지 |
| 비중 | 1.713 |
| 용해도 | 물에 부분적으로 용해됩니다. |
| BRN | 1800087 |
| 헨리 상수 | 6.7×10-1 mol/(m3Pa) at 25℃, Kwan (2001) |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | InChI=1S/C5HF9O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16) |
| InChIKey | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| EPA | Perfluorovaleric acid (2706-90-3) |
화학적 성질
colourless liquid
안전 및 규제
| GHS 분류 | DangerH314 (98.1%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 52 reports by companies from 4 notifications to the ECHA C&L Inventory.H318: Causes serious eye damage [Danger Serious eye damage/eye irritation] |
|---|---|
| 규제 정보 | Chemical: Pentanoic acid, nonafluoro-Hazard Traits - Hazard Trait Undefined |
| 기타 안전 정보 | IMAP assessments - Short chain perfluorocarboxylic acids and their direct precursors: Human health tier II assessment |
| Hazard Classes and Categories | Skin Corr. 1C (98.1%)Eye damage - category 1 |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 관세 코드 | 29159000 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 8Eye Dam. 1Repr. 2 |
| 기존화학 물질 | KE-26085 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Perfluoropentanoic acid is a short-chain perfluorocarboxylic acid (PFCA) generally used as an industrial surfactant and surface protector.