1,3-Dichloro-2-fluoro-5-nitrobenzene
1,3-dichloro-2-fluoro-5-nitrobenzene · uoro-1-nitrob · 3,5-Dichloro-4-fluoro-1-nitrob · 5-Dichloro-4-fluoronitrobenzene · 3,5-DICHLORO-4-FLUORONITROBENZENE · 2,6-DICHLORO-P-NITROFLUOROBENZENE · 4-Fluoro-3,5-dichloronitrobenzene · 3,5 dichloro 4-Fluoro Nirto Benzene
식별자 및 물리적 특성
| CAS No. | 3107-19-5 |
|---|---|
| 분자식 | C6H2Cl2FNO2 |
| 평균 분자량 | 209.99 g/mol |
| 단동위원소 질량 | 208.94466188 g/mol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(F)c(Cl)c1 |
| InChIKey | VMAATSFMXSMKPG-UHFFFAOYSA-N |
| PubChem CID | 76554 |
| EC No. | 221-466-3 |
| DTXSID | DTXSID00185023 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 175 |
| 녹는점 | 44 °C |
| 끓는 점 | 259.3±35.0 °C(Predicted) |
| 밀도 | 1.622±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 가루 |
| 색상 | 하얀색 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P264, P264+P265, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, and P362+P364 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 31-03-2023 https://echa.europa.eu/registration-dossier/-/registered-dossier/34697 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2904990090 |
| 위험 표시 | Xi |
| 위험 참고 사항 | Irritant |
용도
용도
3,5-Dichloro-4-fluoronitrobenzene is an important synthetic chemical raw material for the synthesis of other compounds. It is commonly used in chemical factories and laboratory research.
제조 및 합성 방법
제조 방법
3,5-Dichloro-4-fluoronitrobenzene can be produced by reacting persulfate with ammonium nitrate to form a phosphine salt. The phosphine salt reacts with 3,5-Dichloro-4-fluorobenzene in the presence of hydrogen peroxide to form the desired product. The reaction occurs on a large scale to produce 3,5-dichloro-4-fluoronitrobenzene in high yield.