Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Bromoisonicotinic acid
3-BROMOPYRIDINE-4-CARBOXYLIC ACID · 3-BROMO-4-PYRIDINECARBOXYLIC ACID · IFLAB-BB F1957-0038 · Dry Vitamin E Acetate · 3-Bromoisonicotinicaci · -Bromoisonicotinic acid · (2-azanylphenyl)methanol · 3-BROMOISONICOTINIC ACID
식별자 및 물리적 특성
| CAS No. | 13959-02-9 |
|---|---|
| 분자식 | C6H4BrNO2 |
| 평균 분자량 | 202.01 g/mol |
| 단동위원소 질량 | 200.94254047 g/mol |
| SMILES | O=C(O)c1ccncc1Br |
| InChIKey | AVXWWBFBRTXBRM-UHFFFAOYSA-N |
| PubChem CID | 817972 |
| EC No. | 675-789-3 |
| DTXSID | DTXSID60355886 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 50.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 140 |
| 녹는점 | 237-238 |
| 끓는 점 | 403.1±30.0 °C(Predicted) |
| 밀도 | 1.813±0.06 g/cm3(Predicted) |
| 인화점 | 197. |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| pKa(산도 계수) | 0.60±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 회백색 |
| InChI | InChI=1S/C6H4BrNO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3H,(H,9,10) |
| InChIKey | AVXWWBFBRTXBRM-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C(O)=O)=C1Br |
안전 및 규제
| GHS 분류 | WarningH302 (87%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (87%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2933399990 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36/37/39-22 |
| 위험 등급 | IRRITANTAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Bromoisonicotinic acid, as the most important intermediate in isonicotinic acid derivatives, is mainly used in the manufacture of anti-tuberculosis drugs, but also in the synthesis of amides, hydrazides, esters and other derivatives.