Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 840517생성일: 2026년 10월 23일
5-(3-브로모페닐)푸란-2-카브알데히드
5-(3-브로모페닐)푸란-2-카브알데히드 · 5-(3-bromophenyl)-2-Furancarboxaldehyde · 2-Furancarboxaldehyde, 5-(3-bromophenyl)-
https://huagongshe.com/ko/chemical/840517
식별자 및 물리적 특성
| CAS No. | 39868-10-5 |
|---|
| 분자식 | C11H7BrO2 |
|---|
| 평균 분자량 | 251.08 g/mol |
|---|
| 단동위원소 질량 | 249.96294156 g/mol |
|---|
| SMILES | O=Cc1ccc(-c2cccc(Br)c2)o1 |
|---|
| InChIKey | NUOIWDFBKGEKJD-UHFFFAOYSA-N |
|---|
| PubChem CID | 840517 |
|---|
| EC No. | 893-823-7 |
|---|
| DTXSID | DTXSID50357031 |
|---|
| 현지명 | 5-(3-브로모페닐)푸란-2-카브알데히드 |
|---|
화학 및 물리적 성질
| XLogP | 3.1 |
|---|
| 극성 표면적 | 30.2 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 14 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 207 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (50%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (50%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H315 |
|---|
