Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-Dimethyl-3-nitropyridine
3-NITRO-2,6-LUTIDINE · 3-Bromo-3-Nitropyridine · 3-Nitro-2,6-lutidine,99% · 3-NITRO-2,6-DIMETHYLPYRIDINE · 2,6-DIMETHYL-3-NITROPYRIDINE · 2,6-DiMethyl-3-nitroypyridine · Pyridine,2,6-diMethyl-3-nitro- · 2,6-Dimethyl-3-nitropyridine >2,6-Dimethyl-3-nitropyridine ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 15513-52-7 |
|---|---|
| 분자식 | C7H8N2O2 |
| 평균 분자량 | 152.15 g/mol |
| 단동위원소 질량 | 152.0585775 g/mol |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)n1 |
| InChIKey | AETHUDGJSSKZKT-UHFFFAOYSA-N |
| PubChem CID | 84958 |
| EC No. | 239-543-5 |
| DTXSID | DTXSID10165816 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 58.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 155 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 26-31 °C (lit.) |
| 끓는 점 | 105°C/10mmHg(lit.) |
| 밀도 | 1.45 |
| 인화점 | 100 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 2+-.0.10(Predicted) |
| 색상 | 회백색부터 황갈색까지 |
| InChI | 1S/C7H8N2O2/c1-5-3-4-7(9(10)11)6(2)8-5/h3-4H,1-2H3 |
| InChIKey | AETHUDGJSSKZKT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(C)n1)[N+]([O-])=O |
화학적 성질
Off-white to tan powder
안전 및 규제
| GHS 분류 | DangerH228 (100%): Flammable solid [Danger Flammable solids]P210, P240, P241, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Sol. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1325 4.1/PG 3 |
| 관세 코드 | 29333999 |
| 위험 문구(R) | 11-36/37/38 |
| 위험 표시 | F,Xi,Xn |
| 안전 문구(S) | 16-26-36 |
| 포장분류 | III |
| 위험 등급 | 4.1Eye Irrit. 2Flam. Sol. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 4.1B - Flammable solid hazardous materials |
용도
용도
3-Nitro-2,6-lutidine may be used in the preparation of 3-methoxy-2,7-dimethyl-2H-1,4-diazepine1 and 3-amino-2,6-lutidine.
일반 설명
3-Nitro-2,6-lutidine, a nitropyridine derivative, is also known as 2,6-dimethyl-3-nitropyridine. It can be prepared from 2,6-lutidine via nitration.