Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Cyclohexylpiperazine
AKOS BBS-00003612 · BUTTPARK 82\06-06 · TIMTEC-BB SBB003875 · Avatopal impurity 47 · N-Cyclohexylpiperazine · 1-Cyclohexylpiperizine · 1-CYCLOHEXYLPIPERAZINE · Avatrombopag Impurity 9
식별자 및 물리적 특성
| CAS No. | 17766-28-8 |
|---|---|
| 분자식 | C10H20N2 |
| 평균 분자량 | 168.28 g/mol |
| 단동위원소 질량 | 168.16264864 g/mol |
| SMILES | C1CCC(N2CCNCC2)CC1 |
| InChIKey | XPDSXKIDJNKIQY-UHFFFAOYSA-N |
| PubChem CID | 87298 |
| ChEMBL | CHEMBL574182 |
| EC No. | 241-750-0 |
| DTXSID | DTXSID40170357 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 15.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 124 |
| 녹는점 | 28-32 °C |
| 끓는 점 | 287.25°C (rough estimate) |
| 밀도 | 0.9725 (rough estimate) |
| 굴절률 | 1.6011 |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 저융점 고체 |
| pKa(산도 계수) | 9.25±0.10(Predicted) |
| 색상 | 갈색을 띤 노란색 |
| BRN | 106845 |
| InChI | InChI=1S/C10H20N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h10-11H,1-9H2 |
| InChIKey | XPDSXKIDJNKIQY-UHFFFAOYSA-N |
| SMILES | N1(C2CCCCC2)CCNCC1 |
화학적 성질
yellow-brownish low melting solid
안전 및 규제
| GHS 분류 | WarningH315 (95.3%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (95.3%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25-26 |
| 위험 참고 사항 | Irritant |
용도
용도
1-Cyclohexylpiperazine is an σ1 and σ2 receptor ligands with diagnostic and therapeutic potentials.