HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Diosbulbin D
Diosbulbin D · 2-(furan-3-yl)-11b-methyloctahydro-2h-7,10-methanooxepino[4,5-f]isochromene-4,6,8(1h)-trione · 7,10-Methano-2H-pyrano[4,3-g][3]benzoxepin-4,6,8(1H)-trione, 2-(3-furanyl)octahydro-11b-methyl-, (2S,4aS,6aS,7R,10R,11aR,11bS)- · (2S)-2β-(3-Furyl)-4aα,5,6aβ,7,10,11,11aα,11b-octahydro-11bβ-methyl-7β,10β-methano-2H-pyrano[4,3-g][3]benzoxepine-4,6,8(1H)-trione
Identifikatoren & physikalische Daten
| CAS No. | 66756-57-8 |
|---|---|
| Summenformel | C19H20O6 |
| Durchschnittliche Molmasse | 344,4 g/mol |
| Monoisotopische Masse | 344,12598835 g/mol |
| SMILES | CC12CC(c3ccoc3)OC(=O)C1CC(=O)C1C3CC(CC12)OC3=O |
| InChIKey | FJCWYLRNGKSUCH-UHFFFAOYSA-N |
| PubChem CID | 100021 |
| ChEBI | CHEBI:175356 |
| DTXSID | DTXSID50985333 |
Chemische & physikalische Eigenschaften
| XLogP | 1,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 82,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 644 |
| Siedepunkt | 599.148±50.00 °C(Press: 760.00 Torr)(predicted) |
| Dichte | 1.323±0.06 g/cm3(Temp: 25 °CPress: 760 Torr)(predicted) |
| Löslichkeit | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| Aggregatzustand | Powder |
Anwendungen & Verwendung
Verwenden
Diosbulbin D has shown to induce cytotoxicity against human hepatocellular carcinoma cells, apoptosis in normal human liver L-02 cells, and constitutes of anti-inflammatory properties.