HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Flurenol
FLURENOL · flurecol · Flurenol [ISO] · FLURENOL PESTANAL · flurenol (bsi,iso) · Flurecol [BSI:ISO] · 9-Hydroxy-9-fluorene · 9-hydroxy-fluorene-9-acid
Identifikatoren & physikalische Daten
| CAS No. | 467-69-6 |
|---|---|
| Summenformel | C14H10O3 |
| Durchschnittliche Molmasse | 226,23 g/mol |
| Monoisotopische Masse | 226,06299418 g/mol |
| SMILES | O=C(O)C1(O)c2ccccc2-c2ccccc21 |
| InChIKey | GXAMYUGOODKVRM-UHFFFAOYSA-N |
| PubChem CID | 10087 |
| ChEMBL | CHEMBL1452438 |
| ChEBI | CHEBI:82015 |
| EC No. | 207-397-1 |
| DTXSID | DTXSID0075029 |
| Lokaler Name | Flurenol |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 57,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 303 |
| Schmelzpunkt | 162-166 °C (lit.) |
| BRN | 1314711 |
| InChI | 1S/C14H10O3/c15-13(16)14(17)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,17H,(H,15,16) |
| InChIKey | GXAMYUGOODKVRM-UHFFFAOYSA-N |
| SMILES | OC(=O)C1(O)c2ccccc2-c3ccccc13 |
| CAS Datenbank | 467-69-6(CAS DataBase Reference) |
| EPA chemische Informationen | Flurenol (467-69-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | H411: Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard]P273, P391, and P501 (click each P-code to see the statement)H411 (100%): Toxic to aquatic life with long lasting effects [Hazardous to the aquatic environment, long-term hazard] |
|---|---|
| Regulatorische Informationen | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance.2004/129/EC |
| Hazard Classes and Categories | Aquatic Chronic 2 (100%)Hazardous to the aquatic environment (chronic) - category 2Aquatic Chronic 2 |
| Wassergefährdungsklasse (WGK) | 2 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3082 9/PG 3 |
| Zollcode | 29181990 |
| RTECS-Nr. | LL6480000 |
| R-Sätze (R) | 51/53-36/37/38 |
| Toxizität | mouse,LD50,oral,> 5gm/kg (5000mg/kg),Pesticide Manual. Vol. 9, Pg. 417, 1991. |
| Gefahrensymbole | N,Xi |
| Sicherheitshinweise (S) | 61-36/37/39-27-26 |
| Gefahrenklasse | 9Aquatic Chronic 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
9-Hydroxy-9-fluorenecarboxylic acid was used in the synthesis of a hexameric organooxotin prismane.