HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
α-Methylpyridin-3-methanol
1-(3-Pyridyl)ethanol · 1-PYRIDIN-3-YL-ETHANOL · 3-Pyridylmethylcarbinol · Methyl-3-pyridylcarbinol · 3-METHYLPYRIDINECARBINOL · 3-(1-Hydroxyethyl)pyridine · a-Methyl-3-PyridineMethanol · α-Methyl-3-pyridinemethanol
Identifikatoren & physikalische Daten
| CAS No. | 10593-35-8 |
|---|---|
| Summenformel | C7H9NO |
| Durchschnittliche Molmasse | 123,15 g/mol |
| Monoisotopische Masse | 123,06841391 g/mol |
| SMILES | CC(O)c1cccnc1 |
| InChIKey | QMDUEBURHKSKDG-UHFFFAOYSA-N |
| PubChem CID | 101192 |
| EC No. | 225-280-3 |
| DTXSID | DTXSID20909829 |
| Lokaler Name | α-Methylpyridin-3-methanol |
Chemische & physikalische Eigenschaften
| XLogP | 1 |
|---|---|
| Polarare Oberfläche (TPSA) | 33,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 85 |
| Siedepunkt | 123-125 °C(Press: 5 Torr) |
| Dichte | 1.082±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| pKa (Säurekonstante) | 13.75±0.20(Predicted) |
| Aggregatzustand | liquid |
| Farbe | light brown |
| InChI | InChI=1S/C7H9NO/c1-6(9)7-3-2-4-8-5-7/h2-6,9H,1H3 |
| InChIKey | QMDUEBURHKSKDG-UHFFFAOYSA-N |
| SMILES | C1(C(O)C)=CN=CC=C1 |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Zollcode | 2933399990 |
| Gefahrensymbole | Xi |
Anwendungen & Verwendung
Verwenden
The functional group of 3-(1-Hydroxyethyl)pyridine is a hydroxyl group. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.