HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ethylenediamine diacetate
1,2-Ethanediamine, acetate (1:2) · Ethylenediamine diacetate · Ethanediammonium Diacetate · ethane-1,2-diaMine diacetate · aceticacid,ethane-1,2-diamine · EthylenediaMine diacetate 98% · ethyldiaminediacetic acidester
Identifikatoren & physikalische Daten
| CAS No. | 38734-69-9 |
|---|---|
| Summenformel | C6H16N2O4 |
| Durchschnittliche Molmasse | 180,2 g/mol |
| Monoisotopische Masse | 180,11100699 g/mol |
| SMILES | CC(=O)O.CC(=O)O.NCCN |
| InChIKey | SAXQBSJDTDGBHS-UHFFFAOYSA-N |
| PubChem CID | 10154317 |
| DTXSID | DTXSID10436235 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 127 |
|---|---|
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 37 |
| Schmelzpunkt | 118-120 °C(lit.) |
| Lagerbedingungen | -20°C Freezer |
| Löslichkeit | ChloroformDichloromethaneEthyl AcetateToluene |
| Aggregatzustand | Solid |
| Farbe | Off-White |
| BRN | 5444394 |
| InChI | InChI=1S/C2H8N2.C2H4O2/c3-1-2-41-2(3)4/h1-4H21H3,(H,3,4) |
| InChIKey | IENXJNLJEDMNTE-UHFFFAOYSA-N |
| SMILES | C(=O)(O)C.C(N)CN |
Sicherheit & Vorschriften
| F | 9-21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Beschreibung
Das Ethylendiammoniumdiacetat bildet farblose, wasserlösliche, sehr hygroskopische Kristalle. Es ist ein milder und effektiver Katalysator für Umsetzungen CH-acider Verbindungen mit Carbonylgruppen.
Verwenden
1,2-Ethanediamine, acetate (1:2) is used as a catalyst for the preparation of various organic compounds such as methanodibenzodioxocin flavonoids, and chromeno-annulated cis-fused pyrano[3,4-c]benzopyran. It is also useful reagent for the synthesis of organic compunds such as arylmethyl nitrodihydroimidazopyridinium.