HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Zinktrifluoromethansulfonat
Zn(OTf)2 · ZINC TRIFLATE · zinc(ii) triflate · trifluoromethanesulphonate · Zinc trifluoromethylsulfonate · Bis(trifluoromethanesulfonato)zinc · Trifluoromethane sulfonic acid zinc · zinc(2+) ditrifluoromethanesulfonate
Identifikatoren & physikalische Daten
| CAS No. | 54010-75-2 |
|---|---|
| Summenformel | C2F6O6S2Zn |
| Durchschnittliche Molmasse | 363,5 g/mol |
| Monoisotopische Masse | 361,833191 g/mol |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.[Zn+2] |
| InChIKey | CITILBVTAYEWKR-UHFFFAOYSA-L |
| PubChem CID | 104671 |
| EC No. | 258-922-6 |
| DTXSID | DTXSID7068899 |
| Lokaler Name | Zinktrifluoromethansulfonat |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 131 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 12 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 145 |
| Schmelzpunkt | ≥300 °C(lit.) |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Aggregatzustand | Powder |
| Farbe | White to light-gray |
| Löslichkeit | Soluble in water and acetonitrile. Slightly soluble in methanol. Insoluble in dichloromethane. |
| BRN | 4028195 |
| Stabilität | hygroscopic |
| InChI | InChI=1S/2CHF3O3S.Zn/c2*2-1(3,4)8(5,6)7/h2*(H,5,6,7)/q+2/p-2 |
| InChIKey | CITILBVTAYEWKR-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S([O-])(=O)=O.[Zn+2] |
| CAS Datenbank | 54010-75-2(CAS DataBase Reference) |
| EPA chemische Informationen | Methanesulfonic acid, trifluoro-, zinc salt (54010-75-2) |
Sicherheit & Vorschriften
| F | 3-10 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3261 8/PG 2 |
| Zollcode | 29049090 |
| R-Sätze (R) | 34 |
| Gefahrensymbole | C |
| hazard_note | Irritant/Hygroscopic |
| Sicherheitshinweise (S) | 26-36/37/39-45 |
| Gefahrenklasse | 8 |
| Verpackungsgruppe | II |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Zinc trifluoromethanesulfonate acts as a catalyst for the preparation of dithioketals. It is used as a Lewis acid catalyst in silylation reactions. It is also used as a catalyst for greener amine synthesis by reductive amination with hydrogen gas.