Identifikatoren & physikalische Daten
| CAS No. | 25203-63-8 |
|---|
| Summenformel | C9H14ClN3O4 |
|---|
| Durchschnittliche Molmasse | 263,68 g/mol |
|---|
| Monoisotopische Masse | 263,06728361 g/mol |
|---|
| SMILES | Cl.Nc1ccn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)n1 |
|---|
| InChIKey | LTKCXZGFJFAPLY-OERIEOFYSA-N |
|---|
| PubChem CID | 107488 |
|---|
| ChEMBL | CHEMBL1356971 |
|---|
| EC No. | 223-639-9 |
|---|
| DTXSID | DTXSID2074956 |
|---|
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 108 |
|---|
| H-Brücken-Donoren | 4 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 17 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 355 |
|---|
| Löslichkeit | >39.6 [ug/mL] (The mean of the results at pH 7.4) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | Not Classified |
|---|
| Regulatorische Informationen | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance.Cytidine, 2'-deoxy-, monohydrochloride: Does not have an individual approval but may be used under an appropriate group standard |
|---|
| Hazard Classes and Categories | Not Classified |
|---|
