(6r,7r,7As)-n-methylhexahydro-1h-1,6-epoxypyrrolizin-7-amine
loline · Festucine · (2R,3aβ,6aβ)-Hexahydro-N-methyl-2α,4α-methano-4H-furo[3,2-b]pyrrol-3α-amine · 2,4-Methano-4H-furo[3,2-b]pyrrol-3-amine, hexahydro-N-methyl-, (2R,3R,3aS,4S,6aS)-
Identifikatoren & physikalische Daten
| CAS No. | 25161-91-5 |
|---|---|
| Summenformel | C8H14N2O |
| Durchschnittliche Molmasse | 154,21 g/mol |
| Monoisotopische Masse | 154,11061307 g/mol |
| SMILES | CN[C@@H]1[C@H]2C3CCN2C[C@H]1O3 |
| InChIKey | OPMNROCQHKJDAQ-KTUCCBJNSA-N |
| PubChem CID | 107913 |
| DTXSID | DTXSID30948022 |
Chemische & physikalische Eigenschaften
| XLogP | -0,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 24,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 185 |
| Siedepunkt | 103 °C(Press: 5 Torr) |
| Dichte | 1.20±0.1 g/cm3(Predicted) |
| pKa (Säurekonstante) | 9.36±0.20(Predicted) |
Anwendungen & Verwendung
Beschreibung
This oily alkaloid has been obtained from a species of grass, Lotium cuneatum Nevski. It has a density of D 20 1.1343 and a refractive index of n20D 1.5505. It behaves as a diacidic base yielding a series of well crystalline salts and derivatives, e.g. the dihydrochloride, m.p. 256-7°C; [α]15D + 6.2° (H20); dihydrobromide, m.p. 254-5°C (dec.); [α]20D + 3.5° (c 4.29, H20); dihydriodide, m.p. 233-5°C (dec.); [α]34D + 5.0° (c 13.2 H20); perchlorate, m.p. 282°C with almost explosive decomposition; sulphate, yellow needles, m.p. 250-2°C (dec.); mononitrate,m.p. 208-2l0°C; dinitrate, m.p. l48-9°C; [α]38D + 6.18° (c 6.94, H20); dipicrate, m.p. 258-260°C (dec.); methiodide, m.p. 2l0-loC and the N-nitroso derivative, m.p. 64°C. The N-acetyl derivative yields a crystalline hydrochloride, m.p. 197-8°C; [α]20D + 36.9° (H20) and the N-methyl compound is obtained as a colourless oil, b.p. 90-l oC/2 mm; [α]31D+ 9.31° (c 9.5, MeOH). The alkaloid possesses an ether oxygen bridging the pyrrolizidine moiety.