HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 11090199Erstellt: 3. November 2026
1,5-Dibromo-3-fluoro-2-iodobenzene
2,4-Dibromo-6-fluoroiodobenzene · 1,5-Dibromo-3-fluoro-2-iodobenzene · Benzene, 1,5-dibromo-3-fluoro-2-iodo-
https://huagongshe.com/de/chemical/11090199
Identifikatoren & physikalische Daten
| CAS No. | 202982-76-1 |
|---|
| Summenformel | C6H2Br2FI |
|---|
| Durchschnittliche Molmasse | 379,79 g/mol |
|---|
| Monoisotopische Masse | 377,7552 g/mol |
|---|
| SMILES | Fc1cc(Br)cc(Br)c1I |
|---|
| InChIKey | SWURVCDCHYBPGQ-UHFFFAOYSA-N |
|---|
| PubChem CID | 11090199 |
|---|
| EC No. | 107-666-2 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,1 |
|---|
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 10 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 122 |
|---|
| Siedepunkt | 293.5±35.0 °C(Predicted) |
|---|
| Dichte | 2.564±0.06 g/cm3(Predicted) |
|---|
| InChI | InChI=1S/C6H2Br2FI/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
|---|
| InChIKey | SWURVCDCHYBPGQ-UHFFFAOYSA-N |
|---|
| SMILES | C1(Br)=CC(Br)=CC(F)=C1I |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H315 |
|---|
