HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Nicotinohydrazid
NICOTINIC HYDRAZIDE · ws102 · Niazid · WS 102 · NSC 36088 · 3-Isoniazid · WLN: T6NJ CVMZ · AKOS BBS-00004102
Identifikatoren & physikalische Daten
| CAS No. | 553-53-7 |
|---|---|
| Summenformel | C6H7N3O |
| Durchschnittliche Molmasse | 137,14 g/mol |
| Monoisotopische Masse | 137,05891186 g/mol |
| SMILES | NNC(=O)c1cccnc1 |
| InChIKey | KFUSANSHCADHNJ-UHFFFAOYSA-N |
| PubChem CID | 11112 |
| ChEMBL | CHEMBL124495 |
| EC No. | 209-041-0 |
| DTXSID | DTXSID6020933 |
| Lokaler Name | Nicotinohydrazid |
Chemische & physikalische Eigenschaften
| XLogP | -0,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 68 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 126 |
| Schmelzpunkt | 159-161 °C(lit.) |
| Siedepunkt | 251.97°C (rough estimate) |
| Dichte | 1.2620 (rough estimate) |
| Brechungsindex | 1.6910 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | H2O: soluble50mg/mLSoluble in alcohol, water. |
| Aggregatzustand | Fine Needle-Like Crystalline Powder |
| pKa (Säurekonstante) | 11.43±0.10(Predicted) |
| Farbe | White to off-white |
| BRN | 119299 |
| InChI | InChI=1S/C6H7N3O/c7-9-6(10)5-2-1-3-8-4-5/h1-4H,7H2,(H,9,10) |
| InChIKey | KFUSANSHCADHNJ-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1C(NN)=O |
| CAS Datenbank | 553-53-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | UN2811 |
| Zollcode | 29280000 |
| RTECS-Nr. | QT1750000 |
| R-Sätze (R) | 36/37/38 |
| Toxizität | LD50 intravenous in mouse: 180mg/kg |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 22-26-36/37/39 |
| Gefahrenklasse | 6.1Eye Irrit. 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Nicotinic hydrazide was used in hydrazone library formation. It was used to study the oxidation of isonicotinic acid hydrazide (isoniazid) by horseradish peroxidase.