HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Saccharose
SUGAR · SACCHAROSE · CANE SUGAR · White sugar · Granulated sugar · b-D-Fructofuranosyl-a-D-glucopyranoside · (2R,3R,4S,5S,6R)-2-(((2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxyMethyl)tetrahydrofuran-2-yl)oxy)-6-(hydroxyMethyl)tetrahydro-2H-pyran-3,4,5-triol · Sucrose BP
Identifikatoren & physikalische Daten
| CAS No. | 57-50-1 |
|---|---|
| Summenformel | C12H22O11 |
| Durchschnittliche Molmasse | 342,3 g/mol |
| Monoisotopische Masse | 342,11621152 g/mol |
| SMILES | OCC1OC(OC2(CO)OC(CO)C(O)C2O)C(O)C(O)C1O |
| InChIKey | CZMRCDWAGMRECN-UHFFFAOYSA-N |
| PubChem CID | 1115 |
| ChEBI | CHEBI:193884 |
| DTXSID | DTXSID301355853 |
| Lokaler Name | Saccharose |
Chemische & physikalische Eigenschaften
| XLogP | -3,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 190 |
| H-Brücken-Donoren | 8 |
| H-Brücken-Akzeptoren | 11 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 395 |
| Collision Cross Section | 172.1 Ų [M+Na-H2O]+ [CCS Type: DTMethod: stepped-field] |
| Schmelzpunkt | 185-187 °C (lit.) |
| Siedepunkt | 397.76°C (rough estimate) |
| Dichte | 1.5805 |
| Brechungsindex | 66.5 ° (C=26, H2O) |
| Flammpunkt | 93.3°C |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Löslichkeit | H2O: 500 mg/mL1970 g/L (15 ºC) |
| Aggregatzustand | Liquid |
| pKa (Säurekonstante) | 12.7(at 25℃) |
| Farbe | White |
| pH | 5.0-7.0 (25℃, 1M in H2O) |
| Geruch | Odorless |
| Biologische Quelle | sugar cane |
| Merck | 14,8881 |
| BRN | 90825 |
| Dielektrizitätskonstante | 3.3(Ambient) |
| Stabilität | Stable. Combustible. Incompatible with strong oxidizing agents. Hydrolyzed by dilute acids and by invertase. |
| Kosmetik-Inhaltsstoffe Funktionen | HUMECTANTSKIN CONDITIONINGSOOTHING |
| InChI | 1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| InChIKey | CZMRCDWAGMRECN-UGDNZRGBSA-N |
| SMILES | OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP (Verteilungskoeffizient) | -4.492 (est) |
| CAS Datenbank | 57-50-1(CAS DataBase Reference) |
| NIST chemische Informationen | Sucrose(57-50-1) |
| EPA chemische Informationen | Sucrose (57-50-1) |
| Absorption | ≤0.100 at 280nm≤0.120 at 260nm |
Sicherheit & Vorschriften
| F | 3 |
|---|---|
| Berufliche Expositionsstufe (OEB) | B |
| Arbeitsplatzgrenzwert (OEL) | TWA: 10 mg/m3 (total) |
| Wassergefährdungsklasse (WGK) | 2 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 17019910 |
| RTECS-Nr. | WN6500000 |
| R-Sätze (R) | 36/37/38 |
| Toxizität | LD50 orally in Rabbit: 29700 mg/kg |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 24/25-37/39-26 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 57-50-1(Hazardous Substances Data) |
Anwendungen & Verwendung
Verwenden
sucrose (table sugar) is an emollient, mild emulsifier, and humectant. It can be used in place of glycerin.