Dinatrium-3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalin-1-sulfonat)
DIRECT RED · DIRECT RED 28 · CONGO · kongorot · LITHIUM HYDROXIDE 1H2O · redk · CongoRe · S NO 360
![Molekülstruktur von Dinatrium-3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalin-1-sulfonat)](/img/chemical/11313.png)
Identifikatoren & physikalische Daten
| CAS No. | 573-58-0 |
|---|---|
| Summenformel | C32H22N6Na2O6S2 |
| Durchschnittliche Molmasse | 696,7 g/mol |
| Monoisotopische Masse | 696,08376298 g/mol |
| SMILES | Nc1c(N=Nc2ccc(-c3ccc(N=Nc4cc(S(=O)(=O)[O-])c5ccccc5c4N)cc3)cc2)cc(S(=O)(=O)[O-])c2ccccc12.[Na+].[Na+] |
| InChIKey | IQFVPQOLBLOTPF-UHFFFAOYSA-L |
| PubChem CID | 11313 |
| ChEBI | CHEBI:34653 |
| DTXSID | DTXSID4022816 |
| Lokaler Name | Dinatrium-3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis(4-aminonaphthalin-1-sulfonat) |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 233 |
|---|---|
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 12 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 48 |
| Formalladung | 0 |
| Komplexität | 1.180 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | >360 °C (lit.) |
| Dichte | 0.995 g/mL at 25 °C |
| Dampfdruck | <1 Pa |
| Lagerbedingungen | Store at +5°C to +30°C. |
| Löslichkeit | H2O: soluble10mg/mL |
| Aggregatzustand | Powder/Solid |
| pKa (Säurekonstante) | 4.1(at 25℃) |
| Farbe | Red Brown |
| Geruch | Odorless |
| pH | 6.7 (10g/l, H2O, 20℃) |
| Merck | 14,2498 |
| BRN | 3894858 |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| Hauptanwendungen | Waveguides, optical sensors, display devices, inks, fertilizer, pesticides, carbohydrates, treatment of pathogen infections, age-related macular degeneration |
| InChIKey | IQFVPQOLBLOTPF-HKXUKFGYSA-L |
| SMILES | [Na+].[Na+].Nc1c(cc(c2ccccc12)S([O-])(=O)=O)\N=N\c3ccc(cc3)-c4ccc(cc4)\N=N\c5cc(c6ccccc6c5N)S([O-])(=O)=O |
| CAS Datenbank | 573-58-0(CAS DataBase Reference) |
| EPA chemische Informationen | Congo Red (573-58-0) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29215900 |
| RTECS-Nr. | QK1400000 |
| R-Sätze (R) | 45-63-36 |
| Toxizität | LD50 i.v. in rats: 190 mg/kg (Richardson, Dillon) |
| Gefahrensymbole | T,Xi |
| Sicherheitshinweise (S) | 53-45-37/39-26 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Gefahrstoffdaten | 573-58-0(Hazardous Substances Data) |
| Gefahrenklasse | Carc. 1BRepr. 2 |
Anwendungen & Verwendung
Beschreibung
Kongorot wurde 1884 von Böttiger entdeckt (D.R.P. 28753). Es stellt ein rotbraunes, wasserlösliches Pulver dar. Kongorot war der erste substantive Azofarbstoff, d.h. er konnte Textilfasern (insbesondere Baumwolle) ohne Hilfsmittel, wie Säuren oder Beizen, direkt anfärben. Kongorot wird heute nur noch vereinzelt in der analytischen Chemie zum Nachweis von Säuren verwendet, mit denen eine intensive Blauschwarzfärbung auftritt.
Verwenden
Congo red is useful for staining and visual detection of amyloid deposits. It inhibits the accumulation of the scrapie-associated, protease-resistant isoform of protein PrP without affecting the metabolism of the normal isoform.