HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Cytarabin
CYTOSINE ARABINOSIDE · cytarabin · 4-AMino-1-((2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxyMethyl)tetrahydrofuran-2-yl)pyriMidin-2(1H)-one · DepoCyte · cytosar-u · Cytarabine for Injection · 1-β-D-Arabinofuranosylcytosine · ARA-C
Identifikatoren & physikalische Daten
| CAS No. | 147-94-4 |
|---|---|
| Summenformel | C9H13N3O5 |
| Durchschnittliche Molmasse | 243,22 g/mol |
| Monoisotopische Masse | 243,08552052 g/mol |
| SMILES | Nc1ccn(C2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChIKey | UHDGCWIWMRVCDJ-STUHELBRSA-N |
| PubChem CID | 114682 |
| ChEMBL | CHEMBL605037 |
| DTXSID | DTXSID60953028 |
| Lokaler Name | Cytarabin |
Chemische & physikalische Eigenschaften
| XLogP | -2,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 129 |
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 383 |
| Schmelzpunkt | 214 °C |
| Siedepunkt | 386.09°C (rough estimate) |
| Dichte | 1.3686 (rough estimate) |
| Brechungsindex | 1.5100 (estimate) |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | H2O: 50 mg/mL, clear, colorlessalmost transparency |
| Aggregatzustand | crystalline |
| pKa (Säurekonstante) | pKa 4.3 (Uncertain) |
| Farbe | Prisms from EtOH (aq) |
| Merck | 14,2784 |
| BRN | 89175 |
| Stabilität | Stable for 1 year as supplied from date of purchase. Solutions in DMSO or water may be stored at -20°C for up to 1 month. |
| InChI | 1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | UHDGCWIWMRVCDJ-STUHELBRSA-N |
| SMILES | NC1=NC(=O)N(C=C1)[C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O |
| LogP (Verteilungskoeffizient) | -1.808 (est) |
| CAS Datenbank | 147-94-4(CAS DataBase Reference) |
| EPA chemische Informationen | Cytarabine (147-94-4) |
Sicherheit & Vorschriften
| F | 10-23 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29349990 |
| RTECS-Nr. | HA5425000 |
| R-Sätze (R) | 43-63-36/37/38-20/21/22 |
| Toxizität | LD50 oral in rat: > 5gm/kg |
| Gefahrensymbole | Xn,Xi |
| Sicherheitshinweise (S) | 36/37-37/39-36-26 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 147-94-4(Hazardous Substances Data) |
| Gefahrenklasse | Repr. 2Skin Sens. 1 |
Anwendungen & Verwendung
Verwenden
Cytarabine USP (Cytosar)is used to treat Acute granulocytic leukemia (adults); acute lymphocytic leukemia (children); Hodgkin’s disease