HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 11637322Erstellt: 27. Oktober 2026
2,4-Dichloro-6-(4-fluorophenyl)pyrimidine
2,4-DICHLORO-6-(4-FLUOROPHENYL)PYRIMIDINE · Pyrimidine, 2,4-dichloro-6-(4-fluorophenyl)-
https://huagongshe.com/de/chemical/11637322
Identifikatoren & physikalische Daten
| CAS No. | 833472-84-7 |
|---|
| Summenformel | C10H5Cl2FN2 |
|---|
| Durchschnittliche Molmasse | 243,06 g/mol |
|---|
| Monoisotopische Masse | 241,98138174 g/mol |
|---|
| SMILES | Fc1ccc(-c2cc(Cl)nc(Cl)n2)cc1 |
|---|
| InChIKey | QQLFWYQWFPLRRS-UHFFFAOYSA-N |
|---|
| PubChem CID | 11637322 |
|---|
| EC No. | 109-135-0 |
|---|
| DTXSID | DTXSID30469828 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,9 |
|---|
| Polarare Oberfläche (TPSA) | 25,8 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 210 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| R-Sätze (R) | 22 |
|---|
| Gefahrensymbole | Xn |
|---|
