HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Isopropylmethylether
isopropyl methyl ether · Isopryl · Propane, 2-Methoxy- · Methyl isopropyl ether · Propane, 2-Methoxy-(9CI) · Methyl 1-methylethyl ether · VinylIsobutylEther（Assumed） · Methyl isopropyl ether:2-Methoxypropane
Identifikatoren & physikalische Daten
| CAS No. | 598-53-8 |
|---|---|
| Summenformel | C4H10O |
| Durchschnittliche Molmasse | 74,12 g/mol |
| Monoisotopische Masse | 74,07316494 g/mol |
| SMILES | COC(C)C |
| InChIKey | RMGHERXMTMUMMV-UHFFFAOYSA-N |
| PubChem CID | 11721 |
| ChEBI | CHEBI:53505 |
| EC No. | 209-937-1 |
| DTXSID | DTXSID50208534 |
| Lokaler Name | Isopropylmethylether |
Chemische & physikalische Eigenschaften
| XLogP | 0,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 9,2 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 5 |
| Formalladung | 0 |
| Komplexität | 17,6 |
| SpringerMaterials Properties | Coriolis coupling |
| Schmelzpunkt | -145.22°C |
| Siedepunkt | 30.75°C |
| Dichte | 0.7140 |
| Brechungsindex | 1.3576 |
| Löslichkeit | Chloroform, Methanol (Slightly)61.03g/L(25 ºC) |
| Aggregatzustand | Oil |
| Farbe | Colourless |
| Spezifische Wärmekapazität | Cp(liquid): 2.18 J/(g·K), at 25℃ |
| Henry-Konstante | 1.1×10-2 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Stabilität | Very Volatile |
| InChI | InChI=1S/C4H10O/c1-4(2)5-3/h4H,1-3H3 |
| InChIKey | RMGHERXMTMUMMV-UHFFFAOYSA-N |
| SMILES | CC(OC)C |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P264, P280, P302+P352, P303+P361+P353, P321, P332+P317, P362+P364, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 13 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| Alarmwort | Achtung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H225 |
Anwendungen & Verwendung
Verwenden
2-Methoxy Propane is a synthetic intermediate used for the preparation of various biosynthetic molecules and pharmaceutical goods.