HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Methoxybenzylazidoformiat
NSC-139023 · 4-METHOXYBENZYL AZIDOFORMATE · 4-Methoxybenzyl carbonazidate · 4-Methoxybenzyloxycarbonyl azide · 4-Methoxybenzyloxyformic acid azide · Azidoformic acid p-methoxybenzyl ester · (4-methoxyphenyl)methylN-diazocarbamate · Azidoformic acid (4-methoxyphenyl)methyl ester
Identifikatoren & physikalische Daten
| CAS No. | 25474-85-5 |
|---|---|
| Summenformel | C9H9N3O3 |
| Durchschnittliche Molmasse | 207,19 g/mol |
| Monoisotopische Masse | 207,06439115 g/mol |
| SMILES | COc1ccc(COC(=O)N=[N+]=[N-])cc1 |
| InChIKey | NQBRFIXRZDTIRQ-UHFFFAOYSA-N |
| PubChem CID | 117521 |
| EC No. | 247-017-1 |
| DTXSID | DTXSID00180159 |
| Lokaler Name | 4-Methoxybenzylazidoformiat |
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 49,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 255 |
| Schmelzpunkt | 30-32 °C (lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | powder |
| InChI | 1S/C9H9N3O3/c1-14-8-4-2-7(3-5-8)6-15-9(13)11-12-10/h2-5H,6H2,1H3 |
| InChIKey | NQBRFIXRZDTIRQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)N=[N+]=[N-])cc1 |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH272 (100%): May intensify fireoxidizer [Danger Oxidizing liquidsOxidizing solids]P210, P220, P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, P370+P378, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Ox. Sol. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1479 5.1/PG 2 |
| R-Sätze (R) | 5-20/21/22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36 |
| Lagerklasse | 5.1B - Oxidizing hazardous materials |
| Gefahrenklasse | Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralOx. Sol. 2 |
Anwendungen & Verwendung
Verwenden
4-Methoxybenzyloxycarbonyl azide was used to prepare N-4-methoxybenzyloxycarbonyl-L-α-aminoadipic acid.