HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-(tert-Butoxycarbonyl)-4-nitro-3-phenyl-L-alanin
Phe(4-NO2) · BOC-PHE(4-NO2)-OH · D-Phe.otBu.HCl · BOC-L-4-NITROPHE · BOC-L-PHE(4-NO2) · Boc-4-NO2-Phe-OH · BOC-PHE(4''-NO2) · BOC-(P-NO2)PHE-OH
Identifikatoren & physikalische Daten
| CAS No. | 33305-77-0 |
|---|---|
| Summenformel | C14H18N2O6 |
| Durchschnittliche Molmasse | 310,3 g/mol |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChIKey | XBQADBXCNQPHHY-UHFFFAOYSA-N |
| PubChem CID | 118071 |
| Lokaler Name | N-(tert-Butoxycarbonyl)-4-nitro-3-phenyl-L-alanin |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 121 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 418 |
| Schmelzpunkt | 107°C |
| Siedepunkt | 509.3±45.0 °C(Predicted) |
| Dichte | 1.290±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Chloroform (Slightly), Ethanol (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 3.70±0.10(Predicted) |
| Farbe | Pale Beige |
| BRN | 2820671 |
| Hauptanwendungen | peptide synthesis |
| InChI | InChI=1S/C14H18N2O6/c1-14(2,3)22-13(19)15-11(12(17)18)8-9-4-6-10(7-5-9)16(20)21/h4-7,11H,8H2,1-3H3,(H,15,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | XBQADBXCNQPHHY-NSHDSACASA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C([N+]([O-])=O)C=C1)NC(OC(C)(C)C)=O |
| CAS Datenbank | 33305-77-0 |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29242990 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 24/25 |
| Gefahrenklasse | IRRITANT |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
N-Boc-p-nitro-L-phenylalanine is the N-Boc protected form of p-Nitro-L-phenylalanine (N502725, Hydrate) and is a useful synthetic intermediate in the synthesis of Hydroxymelphalan (H939850); an analog of Melphalan (M216900) which is an antineoplastic.