HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methyl-2-chlorbenzoat
RARECHEM AL BF 0018 · Methyl 2-chlorobenzo · 2-methylchlorobenzoate · Decitabine Impurity 70 · METHYL 2-CHLOROBENZOATE · METHYL O-CHLOROBENZOATE · 2-Chlorobenzoic acid methyl · Methyl 2-Chlorobenzoate >Methyl 2-chlorobenzoate 99+%
Identifikatoren & physikalische Daten
| CAS No. | 610-96-8 |
|---|---|
| Summenformel | C8H7ClO2 |
| Durchschnittliche Molmasse | 170,59 g/mol |
| Monoisotopische Masse | 170,01345714 g/mol |
| SMILES | COC(=O)c1ccccc1Cl |
| InChIKey | JAVRNIFMYIJXIE-UHFFFAOYSA-N |
| PubChem CID | 11895 |
| ChEMBL | CHEMBL3188361 |
| EC No. | 210-242-0 |
| DTXSID | DTXSID8044701 |
| Lokaler Name | Methyl-2-chlorbenzoat |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 147 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP (Verteilungskoeffizient) | 2.38 |
| Schmelzpunkt | 233-235 °C |
| Siedepunkt | 233-235 °C |
| Dichte | 1.191 g/mL at 25 °C(lit.) |
| Brechungsindex | 1.5351-1.537 |
| Flammpunkt | 108 °C |
| Lagerbedingungen | Store below +30°C. |
| Aggregatzustand | Liquid |
| Wichte | 1.191 |
| Farbe | Clear colorless |
| BRN | 1364684 |
| InChI | InChI=1S/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| InChIKey | JAVRNIFMYIJXIE-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1Cl |
| CAS Datenbank | 610-96-8(CAS DataBase Reference) |
| NIST chemische Informationen | 6-Chlorobenzoic acid, methyl ester(610-96-8) |
| EPA chemische Informationen | Methyl-2-chlorobenzoate (610-96-8) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29163990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 24/25 |
| Gefahrenklasse | IRRITANT |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
Methyl 2-chlorobenzoate may be used in the synthesis of various quinazolinone derivatives. It was used as starting reagent in the synthesis of 2-chlorobenzohydrazide.