HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methyl-4-nitrobenzoat
METHYL P-NITROBENZOATE · Ethyl 4-nitrobenzo · RARECHEM AL BF 0193 · Methyl 4-nitrobenzoa · METHYL 4-NITROBENZOATE · 2-methyl-4-nitrobenzoate · Methyl4-Nitrobenzoate>Methyl para-nitrobenzoate · p-carbomethoxynitrobenzene
Identifikatoren & physikalische Daten
| CAS No. | 619-50-1 |
|---|---|
| Summenformel | C8H7NO4 |
| Durchschnittliche Molmasse | 181,15 g/mol |
| Monoisotopische Masse | 181,0375077 g/mol |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChIKey | YOJAHJGBFDPSDI-UHFFFAOYSA-N |
| PubChem CID | 12083 |
| ChEMBL | CHEMBL3560114 |
| EC No. | 210-599-2 |
| DTXSID | DTXSID3022085 |
| Lokaler Name | Methyl-4-nitrobenzoat |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 72,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 203 |
| SpringerMaterials Properties | Chemical shift |
| LogP (Verteilungskoeffizient) | 1.94 |
| Schmelzpunkt | 94-96 °C (lit.) 94-96 °C |
| Siedepunkt | 314.24°C (rough estimate) |
| Dichte | 1.4283 (rough estimate) |
| Brechungsindex | 1.5468 (estimate) |
| Flammpunkt | 94-96°C |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Solubility in methanol is almost transparent. |
| Aggregatzustand | powder to crystal |
| Farbe | Light orange to Yellow to Green |
| BRN | 1912198 |
| InChI | 1S/C8H7NO4/c1-13-8(10)6-2-4-7(5-3-6)9(11)12/h2-5H,1H3 |
| InChIKey | YOJAHJGBFDPSDI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1)[N+]([O-])=O |
| CAS Datenbank | 619-50-1(CAS DataBase Reference) |
| NIST chemische Informationen | 4-Nitrobenzoic acid methyl ester(619-50-1) |
| EPA chemische Informationen | Methyl-4-nitrobenzoate (619-50-1) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29163900 |
| RTECS-Nr. | DH5775000 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
It is employed in the biochemical characterization of NfsA, the Escherichia coli major nitroreductase exhibiting a high amino acid sequence homology to Frp, a Vibrio harveyi flavin oxidoreductase.