HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzyl azide
(AZIDOMETHYL)BENZENE · NSC 26304 · Benzyl azide · triazotoluene · α-Azidotoluene · Benzylazide 98% · Benzylazide,94% · alpha-azido-toluen
Identifikatoren & physikalische Daten
| CAS No. | 622-79-7 |
|---|---|
| Summenformel | C7H7N3 |
| Durchschnittliche Molmasse | 133,15 g/mol |
| Monoisotopische Masse | 133,06399722 g/mol |
| SMILES | [N-]=[N+]=NCc1ccccc1 |
| InChIKey | UDLLFLQFQMACJB-UHFFFAOYSA-N |
| PubChem CID | 12152 |
| ChEMBL | CHEMBL3236190 |
| EC No. | 680-691-9 |
| DTXSID | DTXSID90211244 |
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 14,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 132 |
| SpringerMaterials Properties | Boiling point |
| Schmelzpunkt | 157℃ |
| Siedepunkt | 81-83°C 16mm |
| Dichte | 1.0655 |
| Brechungsindex | 1.5341 |
| Flammpunkt | 82-85°C/16mm |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | Liquid |
| Wichte | 1.0655 |
| Löslichkeit | Insoluble in waterMiscible with ethanol and diethyl ether. Immiscible with water. |
| BRN | 636825 |
| InChI | InChI=1S/C7H7N3/c8-10-9-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | UDLLFLQFQMACJB-UHFFFAOYSA-N |
| SMILES | C1(CN=[N+]=[N-])=CC=CC=C1 |
| CAS Datenbank | 622-79-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P234, P235, P240, P241, P242, P243, P260, P264, P264+P265, P270, P280, P302+P352, P303+P361+P353, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P370+P380+P375[+P378], P403, P403+P235, P410, P411, P420, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 1993 |
| Zollcode | 29299090 |
| R-Sätze (R) | 2-11-48/20/21/22-40 |
| Gefahrensymbole | Xi,Xn |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 15-17-33-36/37 |
| Gefahrenklasse | 3Carc. 2Eye Irrit. 2Skin Irrit. 2STOT RE 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 6.1D - Non-combustible acute toxic Cat.3toxic hazardous materials or hazardous materials causing chronic effects |
Anwendungen & Verwendung
Verwenden
BENZYL AZIDE was used in the synthesis of stable 1,2,3-triazole derivatives.