HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
m-Diiodbenzol
M-DIIODOBENZENE · 1,3-diiodo-benzen · Benzene,m-diiodo- · 1,3-Diiodobenzene · Benzene, m-diiodo- · benzene,1,3-diiodo- · Benzene, 1,3-diiodo- · 1,3-Diiodobenzene >1,3-Phenylene diiodide
Identifikatoren & physikalische Daten
| CAS No. | 626-00-6 |
|---|---|
| Summenformel | C6H4I2 |
| Durchschnittliche Molmasse | 329,9 g/mol |
| Monoisotopische Masse | 329,84024613 g/mol |
| SMILES | Ic1cccc(I)c1 |
| InChIKey | SFPQFQUXAJOWNF-UHFFFAOYSA-N |
| PubChem CID | 12270 |
| EC No. | 210-921-1 |
| DTXSID | DTXSID9060811 |
| Lokaler Name | m-Diiodbenzol |
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 64,9 |
| SpringerMaterials Properties | Crystal structure |
| Schmelzpunkt | 34-37 °C (lit.) |
| Siedepunkt | 285°C |
| Dichte | 2.47 |
| Brechungsindex | 1.7179 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Chloroform, Methanol (Slightly, Heated)Insoluble in water. Soluble in hot methanol. |
| Aggregatzustand | Low Melting Crystalline Mass, Powder or Crystals |
| Farbe | Yellow to beige |
| BRN | 1904540 |
| InChI | InChI=1S/C6H4I2/c7-5-2-1-3-6(8)4-5/h1-4H |
| InChIKey | SFPQFQUXAJOWNF-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=CC(I)=C1 |
| CAS Datenbank | 626-00-6(CAS DataBase Reference) |
| EPA chemische Informationen | Benzene, 1,3-diiodo- (626-00-6) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29039990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
1,3-Diiodobenzene may be used in the synthesis of:3,5-bis(perfluorodecyl)phenylboronic acidepitaxially aligned and separated polyphenylene lines on Cu(110)1,3-bis(4-ethynyl-2,5-dibutoxyphenyl-1-ethynyl)benzene