HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzoglutarsaeureanhydrid
Isochromane-1,3-dione · Isochroman-1,3-dione · 1,3-ISOCHROMANDIONE · 1,3-isochromanedione · Homophtalic anhydride · HOMOPHTHALIC ANHYDRIDE · homophthalic?anhydirde · benzoglutaric anhydride
Identifikatoren & physikalische Daten
| CAS No. | 703-59-3 |
|---|---|
| Summenformel | C9H6O3 |
| Durchschnittliche Molmasse | 162,14 g/mol |
| Monoisotopische Masse | 162,03169405 g/mol |
| SMILES | O=C1Cc2ccccc2C(=O)O1 |
| InChIKey | AKHSBAVQPIRVAG-UHFFFAOYSA-N |
| PubChem CID | 12801 |
| EC No. | 211-873-4 |
| DTXSID | DTXSID00220569 |
| Lokaler Name | Benzoglutarsaeureanhydrid |
Chemische & physikalische Eigenschaften
| XLogP | 0,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 43,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 222 |
| SpringerMaterials Properties | Chemical shift |
| Schmelzpunkt | 140-142 °C(lit.) |
| Siedepunkt | 161°C/1.5mmHg(lit.) |
| Dichte | 1.2599 (rough estimate) |
| Brechungsindex | 1.5380 (estimate) |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | Powder |
| Farbe | Slightly yellow to beige |
| Löslichkeit | Decomposes in water. |
| BRN | 5244 |
| InChI | InChI=1S/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
| InChIKey | AKHSBAVQPIRVAG-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC=CC=C2C1 |
| CAS Datenbank | 703-59-3(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 10-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29173995 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
Anwendungen & Verwendung
Verwenden
It is used as a chemical and organic intermediates.