HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Diphenyliodoniumnitrat
DPIN · ST 279 · ANTIFLAVOG · diphenyl-iodoniunitrate · DIPHENYLIODONIUM NITRATE · Diphenyliodinium nitrate · Diphenyliodonium nitrate,97% · Diphenyliodonium nitrate DPIN
Identifikatoren & physikalische Daten
| CAS No. | 722-56-5 |
|---|---|
| Summenformel | C12H10INO3 |
| Durchschnittliche Molmasse | 343,12 g/mol |
| Monoisotopische Masse | 342,97054 g/mol |
| SMILES | O=[N+]([O-])[O-].c1ccc([I+]c2ccccc2)cc1 |
| InChIKey | CQZCVYWWRJDZBO-UHFFFAOYSA-N |
| PubChem CID | 12876 |
| ChEMBL | CHEMBL3391894 |
| EC No. | 211-962-8 |
| DTXSID | DTXSID00222528 |
| Lokaler Name | Diphenyliodoniumnitrat |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 62,9 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 135 |
| Schmelzpunkt | 150-154 °C (lit.) |
| Dichte | 1.7164 (estimate) |
| Löslichkeit | soluble in MethanolSoluble in hot water |
| Aggregatzustand | powder to crystal |
| Farbe | White to Almost white |
| BRN | 3922747 |
| InChI | InChI=1S/C12H10I.NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-122-1(3)4/h1-10H/q+1 |
| InChIKey | CQZCVYWWRJDZBO-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)[I+]C1=CC=CC=C1.[N+]([O-])([O-])=O |
| CAS Datenbank | 722-56-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH272 (100%): May intensify fireoxidizer [Danger Oxidizing liquidsOxidizing solids]P210, P220, P280, P370+P378, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 89 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Ox. Sol. 3 (100%) |
| F | 8-10 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1479 5.1/PG 2 |
| Zollcode | 29319090 |
| RTECS-Nr. | NN6665000 |
| R-Sätze (R) | 8 |
| Gefahrensymbole | O |
| Sicherheitshinweise (S) | 17-24/25 |
| Gefahrenklasse | 5.1Ox. Sol. 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 5.1B - Oxidizing hazardous materials |
Anwendungen & Verwendung
Verwenden
Cationic photoinitiator. Photoacid generator.