HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Abiraterone acetate N-oxide
Abiraterone Impurity 07 · Abiraterone impurities424 · Acetic acid abiolone impurity 7 · Androsta-5,16-dien-3-ol, 17-(1-oxido-3-pyridinyl)-, 3-acetate, (3β)- · 3-((3S,8R,9S,10R,13S,14S)-3-acetoxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)pyridine 1-oxide · Abiraterone acetate N-oxideQ: What is Abiraterone acetate N-oxide Q: What is the CAS Number of Abiraterone acetate N-oxide Q: What is the storage condition of Abiraterone acetate N-oxide Q: What are the applications of Abiraterone acetate N-oxide
Identifikatoren & physikalische Daten
| CAS No. | 2517964-85-9 |
|---|---|
| Summenformel | C26H33NO3 |
| Durchschnittliche Molmasse | 407,5 g/mol |
| Monoisotopische Masse | 407,24604391 g/mol |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(c4ccc[n+]([O-])c4)=CC[C@@H]32)C1 |
| InChIKey | RHLDSCIZFATDAW-UBUQANBQSA-N |
| PubChem CID | 129012014 |
Chemische & physikalische Eigenschaften
| XLogP | 4,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 51,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 30 |
| Formalladung | 0 |
| Komplexität | 772 |
| Siedepunkt | 570.0±50.0 °C(Predicted) |
| Dichte | 1.24±0.1 g/cm3(Predicted) |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 0.88±0.10(Predicted) |
| Farbe | White to Off-White |
| Stabilität | Light Sensitive |