HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Dimethylzinndichlorid
DMTC · DICHLORODIMETHYLSTANNANE · (CH3)2SnCl2 · DMTC50% · SKL1117 · tin dichL · Two Methyltin · DiMethyltin-di
Identifikatoren & physikalische Daten
| CAS No. | 753-73-1 |
|---|---|
| Summenformel | C2H6Cl2Sn |
| Durchschnittliche Molmasse | 219,68 g/mol |
| Monoisotopische Masse | 219,886858 g/mol |
| SMILES | [CH3][Sn]([CH3])([Cl])[Cl] |
| InChIKey | PKKGKUDPKRTKLJ-UHFFFAOYSA-L |
| PubChem CID | 12955 |
| EC No. | 212-039-2 |
| DTXSID | DTXSID5027304 |
| Lokaler Name | Dimethylzinndichlorid |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 5 |
| Formalladung | 0 |
| Komplexität | 30 |
| Schmelzpunkt | 101-106 °C (lit.) |
| Siedepunkt | 188-190°C |
| Dichte | 1,397 g/cm3 |
| Dampfdruck | 4Pa at 20℃ |
| Flammpunkt | 185-190°C |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | methanol: 0.1 g/mL, clearSlightly soluble in water (20 g/L (20°C)). Solubility in other solvents (0.1 g/ml in methanol). |
| Aggregatzustand | crystal |
| Farbe | white |
| Wichte | 1.397 |
| BRN | 3660508 |
| Stabilität | Hygroscopic, Moisture sensitive |
| InChI | 1S/2CH3.2ClH.Sn/h2*1H3/q+2/p-2 |
| InChIKey | PKKGKUDPKRTKLJ-UHFFFAOYSA-L |
| SMILES | C[Sn](C)(Cl)Cl |
| LogP (Verteilungskoeffizient) | -2.18 at 22℃ |
| CAS Datenbank | 753-73-1(CAS DataBase Reference) |
| EPA chemische Informationen | Stannane, dichlorodimethyl- (753-73-1) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2923 8/PG 2 |
| Zollcode | 29319090 |
| RTECS-Nr. | WH7245000 |
| R-Sätze (R) | 23/24/25-36/37/38-34 |
| Gefahrensymbole | T |
| Sicherheitshinweise (S) | 26-36/37/39-45 |
| Gefahrenklasse | 6.1Acute Tox. 2 InhalationAcute Tox. 3 DermalAcute Tox. 3 OralAquatic Chronic 3Eye Dam. 1Repr. 2Skin Corr. 1BSTOT RE 1 |
| Verpackungsgruppe | II |
| Lagerklasse | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
Anwendungen & Verwendung
Verwenden
Used as a pharmaceutical intermediate. It is employed as a coating, plastic and rubber auxilliary agent. Used as methyl Tin stabilizer intermediates, catalysts for esterification reaction, raw material for glass coating.