HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,4,6-Trimethylstyrol
Mesitylethylene · VINYLMESITYLENE · 2-VINYLMESITYLENE · 2,4,6-TRIMETHYLSTYRENE · styrene,2,4,6-trimethyl- · Styrene, 2,4,6-trimethyl- · 2,4,6-TriMethylstyrene 1,3,5-TRIMETHYL-2-VINYLBENZENE · 1-ethenyl-2,4,6-trimethylbenzene
Identifikatoren & physikalische Daten
| CAS No. | 769-25-5 |
|---|---|
| Summenformel | C11H14 |
| Durchschnittliche Molmasse | 146,23 g/mol |
| Monoisotopische Masse | 146,10955045 g/mol |
| SMILES | C=Cc1c(C)cc(C)cc1C |
| InChIKey | PDELBHCVXBSVPJ-UHFFFAOYSA-N |
| PubChem CID | 13036 |
| EC No. | 212-205-4 |
| DTXSID | DTXSID20227691 |
| Lokaler Name | 2,4,6-Trimethylstyrol |
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 125 |
| SpringerMaterials Properties | Boiling point |
| Schmelzpunkt | -37°C |
| Siedepunkt | 209 °C (lit.) |
| Dichte | 0.906 g/mL at 25 °C (lit.) |
| Brechungsindex | 1.5320 |
| Flammpunkt | 75°C |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Soluble in methanol. |
| Aggregatzustand | clear liquid |
| Farbe | Colorless to Light yellow |
| BRN | 1904365 |
| InChI | InChI=1S/C11H14/c1-5-11-9(3)6-8(2)7-10(11)4/h5-7H,1H2,2-4H3 |
| InChIKey | PDELBHCVXBSVPJ-UHFFFAOYSA-N |
| SMILES | C1(C)=CC(C)=CC(C)=C1C=C |
| CAS Datenbank | 769-25-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (88.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P321, P330, P332+P317, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (88.9%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 2902.90.3050 |
| R-Sätze (R) | 20/21/22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 23-36/37/39 |
| Lagerklasse | 10 - Combustible liquids |
| Gefahrenklasse | Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 Oral |
Anwendungen & Verwendung
Verwenden
2,4,6-Trimethylstyrene is used as an intermediate to produce other chemicals like 2-Methoxy-1-(2, 4, 6-trimethyl-phenyl)-ethanone.