HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Dicyclohexylphosphin
dicyclohexylphosphane · Dicyclohexylphosphino · 98% Cy2PH · icyclohexylphosphane · dicyclohexyl-phosphin · DICYCLOHEXYLPHOSPHINE · Phosphine,dicyclohexyl- · Bis(cyclohexyl)phosphine
Identifikatoren & physikalische Daten
| CAS No. | 829-84-5 |
|---|---|
| Summenformel | C12H23P |
| Durchschnittliche Molmasse | 198,28 g/mol |
| Monoisotopische Masse | 198,15373737 g/mol |
| SMILES | C1CCC(PC2CCCCC2)CC1 |
| InChIKey | HDULBKVLSJEMGN-UHFFFAOYSA-N |
| PubChem CID | 13239 |
| EC No. | 212-590-9 |
| DTXSID | DTXSID7061190 |
| Lokaler Name | Dicyclohexylphosphin |
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 116 |
| Schmelzpunkt | 2°C |
| Siedepunkt | 129 °C 8 mm Hg |
| Dichte | 0,98 g/cm3 |
| Brechungsindex | n 20/D 1.516 |
| Flammpunkt | 2 °C |
| Lagerbedingungen | 20-25°C |
| Aggregatzustand | liquid |
| Wichte | 0.98 |
| Farbe | colorless to light yellow |
| InChI | InChI=1S/C12H23P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2 |
| InChIKey | HDULBKVLSJEMGN-UHFFFAOYSA-N |
| SMILES | P(C1CCCCC1)C1CCCCC1 |
| CAS Datenbank | 829-84-5 |
| EPA chemische Informationen | Phosphine, dicyclohexyl- (829-84-5) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH225 (70.4%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P222, P231, P233, P240, P241, P242, P243, P260, P261, P262, P264, P264+P265, P270, P271, P273, P280, P301+P316, P301+P330+P331, P302+P335+P334, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P321, P330, P337+P317, P361+P364, P363, P370+P378, P391, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 54 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (70.4%) |
| Wassergefährdungsklasse (WGK) | WGK 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2845 4.2/PG 1 |
| R-Sätze (R) | 17-23/24/25 |
| Gefahrensymbole | F,T |
| Sicherheitshinweise (S) | 17-36/37/39-45 |
| Lagerklasse | 4.2 - Pyrophoric and self-heating hazardous materials |
| Gefahrenklasse | Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 3 OralEye Irrit. 2Pyr. Liq. 1 |
Anwendungen & Verwendung
Verwenden
Wang et al. developed a novel fluorescent probe based on dicyclohexylphosphine for rapid and sensitive detection of HOCl in an aqueous solution. The probe exhibits a significant fluorescence turn-on response to HOCl through the specific oxidative reaction between dicyclohexylphosphine and HOCl[1].