HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
trans-4-Methoxyzimtsure
P-METHOXYCINNAMIC ACID · (E)-3-(4-METHOXYPHENYL)ACRYLIC ACID · 4-methoxycinnamate · TRANS-4-METHOXYCINNAMIC ACID · (E)-Methyl 3-(4-hydroxyphenyl)acrylate · Para Methoxy Cinnamic Acid · PMCA · AKOS BB/0034
Identifikatoren & physikalische Daten
| CAS No. | 830-09-1 |
|---|---|
| Summenformel | C10H10O3 |
| Durchschnittliche Molmasse | 178,18 g/mol |
| Monoisotopische Masse | 178,06299418 g/mol |
| SMILES | COc1ccc(C=CC(=O)O)cc1 |
| InChIKey | AFDXODALSZRGIH-UHFFFAOYSA-N |
| PubChem CID | 13245 |
| DTXSID | DTXSID4048147 |
| Lokaler Name | trans-4-Methoxyzimtsure |
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 46,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 190 |
| SpringerMaterials Properties | Chemical diffusion |
| Schmelzpunkt | 173.5 °C(lit.) |
| Siedepunkt | 250.41°C (rough estimate) |
| Dichte | 1.1479 (rough estimate) |
| Brechungsindex | 1.5088 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | Soluble in dimethyl sulfoxide and methanol. |
| pKa (Säurekonstante) | pK1:4.539 (25°C) |
| Aggregatzustand | Fine Crystalline Powder |
| Farbe | White |
| InChI | InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12) |
| InChIKey | AFDXODALSZRGIH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C=C1 |
| LogP (Verteilungskoeffizient) | 2.680 |
| CAS Datenbank | 830-09-1(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Propenoic acid, 3-(4-methoxyphenyl)-(830-09-1) |
| EPA chemische Informationen | 2-Propenoic acid, 3-(4-methoxyphenyl)- (830-09-1) |
Sicherheit & Vorschriften
| F | 8 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29173990 |
| RTECS-Nr. | UD3391300 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-37/39-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
4-Methoxycinnamic acid(p-MCA) exerted antihyperglycemic/hypoglycemic effect by stimulating insulin secretion from pancreas and could be developed into a new potential for therapeutic agent used in type 2 diabetic patients.