HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1H,1H-Perfluorooctylamine
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluoro-1-octanamine · RARECHEM AL BW 0455 · Ibutilide Impurity 7 · Binimetinib Impurity 6 · 1H,1H-PERFLUOROOCTYLAMINE · 1H,1H-Perfluorooctylamine97% · 1H,1H-Perfluorooctylamine 97% · 1H,1H-PENTADECAFLUOROOCTYLAMINE
Identifikatoren & physikalische Daten
| CAS No. | 307-29-9 |
|---|---|
| Summenformel | C8H4F15N |
| Durchschnittliche Molmasse | 399,1 g/mol |
| Monoisotopische Masse | 399,0104216 g/mol |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChIKey | HZCZXRSVKNFILZ-UHFFFAOYSA-N |
| PubChem CID | 136148 |
| ChEMBL | CHEMBL175420 |
| EC No. | 671-163-9 |
| DTXSID | DTXSID50184723 |
Chemische & physikalische Eigenschaften
| XLogP | 4,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 26 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 16 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 24 |
| Formalladung | 0 |
| Komplexität | 461 |
| PFAS | PFAS -> OECD CategoryPFAS -> Other/unspecified |
| Schmelzpunkt | 240-245 °C (decomp) |
| Siedepunkt | 75 °C |
| Dichte | 1,714 g/cm3 |
| Brechungsindex | 1.305 |
| Flammpunkt | 75°C/50mm |
| Lagerbedingungen | 2-8°C, protect from light |
| Aggregatzustand | solid |
| pKa (Säurekonstante) | 6.05±0.30(Predicted) |
| Wichte | 1.714 |
| Löslichkeit | Not miscible or difficult to mix in water. |
| BRN | 1806966 |
| InChI | 1S/C8H4F15N/c9-2(10,1-24)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h1,24H2 |
| InChIKey | HZCZXRSVKNFILZ-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS Datenbank | 307-29-9(CAS DataBase Reference) |
| EPA chemische Informationen | 1H,1H-Perfluorooctylamine (307-29-9) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (90.9%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 22 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (90.9%) |
| Wassergefährdungsklasse (WGK) | WGK 3 |
| UN-Transportnummer | UN2735 |
| Zollcode | 29211990 |
| R-Sätze (R) | 36/37/38-22 |
| Gefahrensymbole | C,Xn |
| hazard_note | Corrosive |
| Sicherheitshinweise (S) | 26-36/37/39 |
| Gefahrenklasse | 8Acute Tox. 4 InhalationAcute Tox. 4 OralCarc. 2Eye Dam. 1Lact.Repr. 1BSTOT RE 1 |
| Verpackungsgruppe | II |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
Anwendungen & Verwendung
Verwenden
1H,1H-Perfluorooctylamine is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field.