Diphenylsilandiol
DPSD · DIHYDROXYDIPHENYLSILANE · Diphenyldihydroxysilane · DK957 · Z-6047 · DPDHSi · CD6150 · CFS-422
Identifikatoren & physikalische Daten
| CAS No. | 947-42-2 |
|---|---|
| Summenformel | C12H12O2Si |
| Durchschnittliche Molmasse | 216,31 g/mol |
| Monoisotopische Masse | 216,06065615 g/mol |
| SMILES | O[Si](O)(c1ccccc1)c1ccccc1 |
| InChIKey | OLLFKUHHDPMQFR-UHFFFAOYSA-N |
| PubChem CID | 13693 |
| EC No. | 213-427-4 |
| DTXSID | DTXSID3061340 |
| Lokaler Name | Diphenylsilandiol |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 40,5 |
|---|---|
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 174 |
| Stoffklassen | Metals -> Metalloid Compounds (Silicon) |
| SpringerMaterials Properties | 29Si nuclear magnetic resonance spectrum |
| Physical Description | White powder[Aldrich MSDS] |
| Schmelzpunkt | 144-147 °C |
| Siedepunkt | 353°C [760mmHg] |
| Dichte | 0.87 |
| Dampfdichte | >1 (vs air) |
| Dampfdruck | 0Pa at 25℃ |
| Flammpunkt | 129 °F |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Aggregatzustand | Powder |
| pKa (Säurekonstante) | 12.06±0.53(Predicted) |
| Farbe | white |
| Löslichkeit | reacts |
| BRN | 2523445 |
| Stabilität | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C12H12O2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | OLLFKUHHDPMQFR-UHFFFAOYSA-N |
| SMILES | O[Si](O)(c1ccccc1)c2ccccc2 |
| LogP (Verteilungskoeffizient) | 2 at 20℃ |
| CAS Datenbank | 947-42-2(CAS DataBase Reference) |
| NIST chemische Informationen | Diphenyl silanediol(947-42-2) |
| EPA chemische Informationen | Silanediol, diphenyl- (947-42-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | This chemical does not meet GHS hazard criteria for 6.1% (5 of 82) of reports.DangerH228 (64.6%): Flammable solid [Danger Flammable solids]P210, P240, P241, P273, P280, P370+P378, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 82 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Chemical: Silanediol, diphenyl-REACH registered substance: Diphenylsilanediol (EC: 213-427-4) |
| Gefahrenübersicht | Highly flammableMay cause irritation[Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Sol. 2 (64.6%) |
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1325 4.1/PG 3 |
| Zollcode | 29319090 |
| RTECS-Nr. | VV3640000 |
| R-Sätze (R) | 11-10 |
| Gefahrensymbole | F |
| Sicherheitshinweise (S) | 16-22-24/25-37-26 |
| Gefahrenklasse | 4.1Flam. Sol. 1 |
| Verpackungsgruppe | III |
| Lagerklasse | 4.1B - Flammable solid hazardous materials |
Anwendungen & Verwendung
Beschreibung
Diphenylsilanediol is a chemical compound that is used as a catalyst. It can be produced by the reaction of diphenylsilane with sulfuric acid. This chemical has been shown to have high thermal and chemical stability, making it an ideal material for catalytic materials. Diphenylsilanediol has also been shown to be an efficient solid catalyst for synthesizing hydrocarbons from hydrogen fluoride and hydrochloric acid. The efficiency of this catalyst may be due to its ability to reduce the activation energy required for the reaction. Diphenylsilanediol is an important material used to manufacture silicone resins and rubbers. In addition, it is helpful as an additive for organopolysiloxanes that are convertible to the cured solid.
Verwenden
Diphenylsilanediol is used in Medicine field, electronics industry and polymer material.