Identifikatoren & physikalische Daten
| CAS No. | 1423-15-0 |
|---|
| Summenformel | C6F5N3 |
|---|
| Durchschnittliche Molmasse | 209,08 g/mol |
|---|
| Monoisotopische Masse | 209,00123782 g/mol |
|---|
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(F)c(F)c1F |
|---|
| InChIKey | ZDEIQGWACCNREP-UHFFFAOYSA-N |
|---|
| PubChem CID | 136993 |
|---|
| EC No. | 857-583-7 |
|---|
| DTXSID | DTXSID00162011 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|
| Polarare Oberfläche (TPSA) | 14,4 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 240 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P262, P264, P270, P271, P280, P301+P316, P302+P352, P304+P340, P316, P321, P330, P361+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
