HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,3-Benzodioxol-5-yl-1-piperidinylmethanone
1-BCP · 1-BCP, 10 mM in DMSO · Piperonylic acid piperidide · 1-(1,3-BENZODIOXOL-5-YLCARBONYL)PIPERIDINE · 1-(1,3-benzodioxol-5-ylcarbonyl)-piperidin · 1,3-Benzodioxol-5-yl(1-piperidinyl)methanone · Methanone, 1,3-benzodioxol-5-yl-1-piperidinyl- · Benzo[d][1,3]dioxol-5-yl(piperidin-1-yl)methanone
Identifikatoren & physikalische Daten
| CAS No. | 34023-62-6 |
|---|---|
| Summenformel | C13H15NO3 |
| Durchschnittliche Molmasse | 233,26 g/mol |
| Monoisotopische Masse | 233,10519334 g/mol |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChIKey | BXBNADAPIHHXJQ-UHFFFAOYSA-N |
| PubChem CID | 1370 |
| ChEMBL | CHEMBL103469 |
| ChEBI | CHEBI:109531 |
| DTXSID | DTXSID10187634 |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 38,8 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 288 |
| SpringerMaterials Properties | Chemical shift |
| Siedepunkt | 406.9±34.0 °C(Predicted) |
| Dichte | 1.256±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Store at RT |
| Löslichkeit | Soluble to 100 mM in DMSO |
| Aggregatzustand | Powder |
| pKa (Säurekonstante) | -1.10±0.20(Predicted) |
| Farbe | White to off-white |