HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-HO-5-(4'-HO-Biphenyl-4-ylazo)-benzoic acid, sodium salt
Mordant Yellow 36 · C.I.Mordant Yellow 36:C.I.14135 · 2-HO-5-(4'-HO-BIPHENYL-4-YLAZO)-BENZOIC ACID, SODIUM SALT · Benzoic acid, 2-hydroxy-5-[(4'-hydroxy[1,1'-biphenyl]-4-yl)azo]-, monosodium salt
Identifikatoren & physikalische Daten
| CAS No. | 6535-41-7 |
|---|---|
| Summenformel | C19H14N2NaO4 |
| Durchschnittliche Molmasse | 357,3 g/mol |
| Monoisotopische Masse | 357,08512621 g/mol |
| SMILES | O=C(O)c1cc(N=Nc2ccc(-c3ccc(O)cc3)cc2)ccc1O.[Na] |
| InChIKey | XIEDOEJXXSMFIK-UHFFFAOYSA-N |
| PubChem CID | 137228296 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 102 |
|---|---|
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 26 |
| Formalladung | 0 |
| Komplexität | 468 |
Herstellung & Synthese
synthetische
4-(4-Aminophenyl)benzenamine diazotization, and 2-Hydroxybenzoic acidcoupling, and then and dilute sulphuric acid common boiling, make the remnants of diazo into alcohol.